|
| | EZ-LINK (TM) PFP-BIOTIN, 50 MG Basic information |
| Product Name: | EZ-LINK (TM) PFP-BIOTIN, 50 MG | | Synonyms: | (3aS,4S,6aR)-Hexahydro-2-oxo-1H-thieno[3,4-d]imidazole-4-pentanoicacid 2,3,4,5,6-pentafluorophenyl ester;Biotin pentafluorophenyl ester;EZ-LINK (TM) PFP-BIOTIN, 50 MG;Biotin-PFP Biotin pentafluorophenyl ester;Perfluorophenyl 5-((3aS,4S,6aR)-2-oxohexahydro-1H-thieno[3,4-d]imidazol-4-yl)pentanoate;CAS_120550-35-8;Biotin-opfp;(2,3,4,5,6-pentafluorophenyl) 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate | | CAS: | 120550-35-8 | | MF: | C16H15F5N2O3S | | MW: | 410.36 | | EINECS: | 1533716-785-6 | | Product Categories: | | | Mol File: | 120550-35-8.mol |  |
| | EZ-LINK (TM) PFP-BIOTIN, 50 MG Chemical Properties |
| Melting point | 190.0 to 194.0 °C | | Boiling point | 555.3±50.0 °C(Predicted) | | density | 1.441 | | storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C | | form | powder to crystal | | pka | 13.89±0.40(Predicted) | | color | White to Almost white | | InChI | InChI=1S/C16H15F5N2O3S/c17-9-10(18)12(20)15(13(21)11(9)19)26-8(24)4-2-1-3-7-14-6(5-27-7)22-16(25)23-14/h6-7,14H,1-5H2,(H2,22,23,25)/t6-,7-,14-/m0/s1 | | InChIKey | DKTMDBQDSYQUEV-LEJLMFORSA-N | | SMILES | C1(=O)N[C@]2([H])[C@H](CCCCC(OC3=C(F)C(F)=C(F)C(F)=C3F)=O)SC[C@]2([H])N1 | | CAS DataBase Reference | 120550-35-8 |
| | EZ-LINK (TM) PFP-BIOTIN, 50 MG Usage And Synthesis |
| Description | Biotin-PFP ester will react with primary amino groups (-NH2) to form stable, irreversible amide bonds. | | Uses | (+)-Biotin-PFP-ester is used to prepare melampomagnolide B as an antileukemic sesquiterpene. |
| | EZ-LINK (TM) PFP-BIOTIN, 50 MG Preparation Products And Raw materials |
|
