|  | |  |  | Chloropentafluorobenzene Basic information | 
 | Product Name: | Chloropentafluorobenzene |  | Synonyms: | PENTAFLUOROCHLOROBENZENE;Chloropentafluorobenzene,99%;1-Chloro-2,3,4,5,6-pentafluorobenzene;1-chloro-2,3,4,5,6-pentafluoro-benzene;Pentafluorochlorobenzol;Chloropentafluorobenzene, 99% 5GR;1,2,3,4,5-Pentafluoro-6-chlorobenzene;1-Chloropentafluorobenzene |  | CAS: | 344-07-0 |  | MF: | C6ClF5 |  | MW: | 202.51 |  | EINECS: | 206-450-6 |  | Product Categories: | Aryl;C6;Aromatic Hydrocarbons (substituted) & Derivatives;Halogenated  Hydrocarbons;organofluorine compounds;Halogenated Heterocycles ,Pyrimidines;Aryl Fluorinated Building Blocks;Building Blocks;Chemical Synthesis;Fluorinated Building Blocks;Halogenated Hydrocarbons;Organic Building Blocks;Organic Fluorinated Building Blocks;Other Fluorinated Organic Building Blocks |  | Mol File: | 344-07-0.mol |  |  | 
|  |  | Chloropentafluorobenzene Chemical Properties | 
 | Melting point | -15.66°C |  | Boiling point | 122-123 °C/750 mmHg (lit.) |  | density | 1.568 g/mL at 25 °C (lit.) |  | refractive index | n20/D 1.424(lit.) |  | Fp | 116-118°C |  | storage temp. | Refrigerator |  | form | Liquid |  | color | Clear colorless |  | Specific Gravity | 1.651.568 |  | BRN | 1819389 |  | CAS DataBase Reference | 344-07-0(CAS DataBase Reference) |  | EPA Substance Registry System | Benzene, chloropentafluoro- (344-07-0) | 
| Hazard Codes | Xn,Xi |  | Risk Statements | 20-36/37/38 |  | Safety Statements | 23-24/25-26 |  | WGK Germany | 2 |  | RTECS | CZ1225500 |  | Hazard Note | Irritant |  | TSCA | T |  | HS Code | 29039990 |  | Toxicity | dns-rat:lvr 10 mg/L NTIS** AD-A165-849 | 
|  |  | Chloropentafluorobenzene Usage And Synthesis | 
 | Chemical Properties | CLEAR COLOURLESS LIQUID |  | Uses | Chloropentafluorobenzene has been used in the preparation of: 
 1,2-difluoro-1,2-bis-(pentafluorophenyl)dichlorane via fluorination with elemental fluorine at 128°C5-chloro-1-(difluorochloro)-2,3,4,5,6,6-hexafluoro-1,3-cyclohexadiene via reaction with chlorine trifluoride at ?78°C
 |  | General Description | Reaction between chloropentafluorobenzene and strong N-bases in polar aprotic solvents and in the presence of water has been investigated. Chloropentafluorobenzene on reaction with ammonia yields 4-chloro-2,3,5,6-tetrafluoroaniline and 2-chloro-3,4,5,6-tetrafluoroaniline. |  | Safety Profile | Experimental teratogenic effects reported. Mutation data reported. When heated to decomposition it emits toxic vapors of Fí and Clí. | 
|  |  | Chloropentafluorobenzene Preparation Products And Raw materials | 
 |