|
| | 2,5-DIMETHOXY-BETA-NITROSTYRENE Basic information |
| Product Name: | 2,5-DIMETHOXY-BETA-NITROSTYRENE | | Synonyms: | 4-METHOXY-2-[(E)-2-NITROETHENYL]PHENYL METHYL ETHER;1-(2,5-DIMETHOXYPHENYL)-2-NITROETHENE;1,4-DIMETHOXY-2-[(E)-2-NITROETHENYL]BENZENE;1,4-DIMETHOXY-2-(2-NITROVINYL)BENZENE;2-(2,5-DIMETHOXYPHENYL)NITROETHENE;2,5-DIMETHOXY-BETA-NITROSTYRENE;TRANS-2,5-DIMETHOXY-BETA-NITROSTYRENE;2,5-Dimethoxy-beta-nitrostyren | | CAS: | 40276-11-7 | | MF: | C10H11NO4 | | MW: | 209.2 | | EINECS: | 203-130-8 | | Product Categories: | 40276-11-7 | | Mol File: | 40276-11-7.mol |  |
| | 2,5-DIMETHOXY-BETA-NITROSTYRENE Chemical Properties |
| Melting point | 116-120 °C(lit.) | | Boiling point | 348.55°C (rough estimate) | | density | 1.197 | | refractive index | 1.5400 (estimate) | | storage temp. | 2-8°C | | InChI | InChI=1S/C10H11NO4/c1-14-9-3-4-10(15-2)8(7-9)5-6-11(12)13/h3-7H,1-2H3 | | InChIKey | IRRZIWHEPWPPJF-UHFFFAOYSA-N | | SMILES | C1(OC)=CC=C(OC)C=C1C=C[N+]([O-])=O | | CAS DataBase Reference | 40276-11-7(CAS DataBase Reference) |
| | 2,5-DIMETHOXY-BETA-NITROSTYRENE Usage And Synthesis |
| Chemical Properties | orange crystalline powder | | Preparation |
A preparation method of 2, 5-dimethoxy-beta-nitrostyrene, which comprises the following steps: step (1): adding materials 2, 5-dimethoxybenzaldehyde, nitromethane, ammonium acetate and an organic solvent into a reaction kettle, wherein the mass ratio of the materials 2, 5-dimethoxybenzaldehyde to nitromethane to the organic solvent to ammonium acetate is 1:0.7-0.9:4-5:0.25-0.3, and reacting for 4-10 hours at the temperature of 70-80 ℃; step (2) of adding an aqueous solution to the reaction solution obtained in step (1) and washing the mixture to separate the mixture into an aqueous layer and an organic layer; and directly cooling and crystallizing the organic layer, and centrifuging to obtain a finished product of the 2, 5-dimethoxy-beta-nitrostyrene.
|
| | 2,5-DIMETHOXY-BETA-NITROSTYRENE Preparation Products And Raw materials |
|