|
| | 5-Amino-4,6-dichloro-2-methylpyrimidine Basic information | | Appearance |
| Product Name: | 5-Amino-4,6-dichloro-2-methylpyrimidine | | Synonyms: | 2-METHYL-4,6-DICHLORO-5-AMINOPYRIMIDINE;TIMTEC-BB SBB003764;5-AMINO-4,6-DICHLORO-2-METHYLPYRIMIDINE;4,6-DICHLORO-2-METHYLPYRIMIDIN-5-AMINE;4,6-DICHLORO-2-METHYL-PYRIMIDIN-5-YLAMINE;2-Methyl-4,6-dichloro-5-aminop;2-methyl-4,6-dichloro-5-aminopyrimidine (intermediate of moxonidine hcl);5-Amino-4,6-Dichloro-2-Methylpytimidine | | CAS: | 39906-04-2 | | MF: | C5H5Cl2N3 | | MW: | 178.02 | | EINECS: | 419-110-9 | | Product Categories: | Pyridines, Pyrimidines, Purines and Pteredines;Pyrimidine;(intermediate of moxonidine hcl);(intermediate of moxonidine);39906-04-2 | | Mol File: | 39906-04-2.mol |  |
| | 5-Amino-4,6-dichloro-2-methylpyrimidine Chemical Properties |
| Melting point | 70-73 °C (lit.) | | Boiling point | 257.7±35.0 °C(Predicted) | | density | 1.504±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | pka | -2.55±0.39(Predicted) | | form | powder to crystal | | color | White to Yellow to Green | | InChI | InChI=1S/C5H5Cl2N3/c1-2-9-4(6)3(8)5(7)10-2/h8H2,1H3 | | InChIKey | FKRXXAMAHOGYNT-UHFFFAOYSA-N | | SMILES | C1(C)=NC(Cl)=C(N)C(Cl)=N1 | | CAS DataBase Reference | 39906-04-2(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 29335990 |
| | 5-Amino-4,6-dichloro-2-methylpyrimidine Usage And Synthesis |
| Appearance | White to Yellow to Green powder to crystal | | Uses | 5-Amino-4,6-dichloro-2-methylpyrimidine is a useful research chemical for organic synthesis and other chemical and pharmacological processes. |
| | 5-Amino-4,6-dichloro-2-methylpyrimidine Preparation Products And Raw materials |
|
