|
| | 2',3',5'-TRI-O-ACETYLINOSINE Basic information |
| Product Name: | 2',3',5'-TRI-O-ACETYLINOSINE | | Synonyms: | INOSINE 2',3',5'-TRIACETATE;ACETICACID3,4-DIACETOXY-5-(6-HO-PURIN-9-YL)-TETR;2,3,5-TRIACETYLINOS;2',3',5'-Tri-O-acetyl-D-inosine;2,3,5-TRIACETYLINOSINE CRYSTALLINE;(2R,3S,4R,5R)-2-(ACETOXYMETHYL)-5-(6-OXO-1H-PURIN-9(6H)-YL)TETRAHYDROFURAN-3,4-DIYL DIACETATE;2'',3'',5''-TRI-O-ACETYL-INOSIN;2'-O,3'-O,5'-O-Triacetyl-6-hydroxy-6-deaminoadenosine | | CAS: | 3181-38-2 | | MF: | C16H18N4O8 | | MW: | 394.34 | | EINECS: | 221-669-7 | | Product Categories: | Bases & Related Reagents;Nucleotides;Pharmaceutical Raw Materials | | Mol File: | 3181-38-2.mol |  |
| | 2',3',5'-TRI-O-ACETYLINOSINE Chemical Properties |
| Melting point | 234-236°C | | Boiling point | 620.7±65.0 °C(Predicted) | | density | 1.62±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Methanol (Sparingly), Water (Sparingly) | | form | Solid | | pka | 2.96±0.20(Predicted) | | color | White | | Stability: | Freezer | | InChI | InChI=1S/C16H18N4O8/c1-7(21)25-4-10-12(26-8(2)22)13(27-9(3)23)16(28-10)20-6-19-11-14(20)17-5-18-15(11)24/h5-6,10,12-13,16H,4H2,1-3H3,(H,17,18,24)/t10-,12-,13-,16-/m1/s1 | | InChIKey | SFEQTFDQPJQUJM-XNIJJKJLSA-N | | SMILES | C(OC(=O)C)[C@H]1O[C@@H](N2C3C(=C(N=CN=3)O)N=C2)[C@H](OC(=O)C)[C@@H]1OC(=O)C | | CAS DataBase Reference | 3181-38-2(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29349990 |
| | 2',3',5'-TRI-O-ACETYLINOSINE Usage And Synthesis |
| Description | 2',3',5'-Tri-O-acetylinosine has been shown to inhibit the growth of cancer cells, and is also an efficient method for bond cleavage and radiation protection. 2',3',5'-Tri-O-acetylinosine has been shown to bind to pyridinium ions, and it has been used in the synthesis of tetrapeptides with hydroxyl groups or alkylation. | | Chemical Properties | White Crystalline Solid | | Uses | 2',3',5'-Tri-O-acetylinosine is an intermediate used for the synthesis of 6-substituted purine ribosides
| | Uses | An intermediate used for the synthesis of 6-substituted purine ribosides. |
| | 2',3',5'-TRI-O-ACETYLINOSINE Preparation Products And Raw materials |
|
