|  | |  |  | Tetrabutylammonium Difluorotriphenylsilicate Basic information | 
|  |  | Tetrabutylammonium Difluorotriphenylsilicate Chemical Properties | 
 | Melting point | 157-163 °C(lit.) |  | storage temp. | Keep in dark place,Inert atmosphere,Room temperature |  | solubility | soluble in most organic solvents. |  | form | powder to crystal |  | color | White to Almost white |  | Stability: | Hygroscopic, Moisture sensitive |  | InChI | InChI=1S/C18H15F2Si.C16H36N/c19-21(20,16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4/h1-15H;5-16H2,1-4H3/q-1;+1 |  | InChIKey | RQBKGJOQACIQDG-UHFFFAOYSA-N |  | SMILES | [Si-](F)(F)(C1=CC=CC=C1)(C1C=CC=CC=1)C1C=CC=CC=1.[N+](CCCC)(CCCC)(CCCC)CCCC | 
| Hazard Codes | C |  | Risk Statements | 14-34 |  | Safety Statements | 22-26-36/37/39-45 |  | RIDADR | UN 3261 8/PG 2 |  | WGK Germany | 3 |  | HazardClass | 8 |  | PackingGroup | Ⅱ |  | HS Code | 29319090 | 
|  |  | Tetrabutylammonium Difluorotriphenylsilicate Usage And Synthesis | 
 | Chemical Properties | Liquid |  | Physical properties | mp 155–156°C(EtOAc). |  | Uses | Tetrabutylammonium Difluorotriphenylsilicate (Bardac(R) 208M) is a quaternary ammonium based antimicrobial used as a bacteriostat, deodorant, disinfectant and(or) a microbiocide. |  | Uses | A fluoride source for nucleophilic fluorination. |  | Uses | Tetrabutylammonium Difluorotriphenylsilicate is non-hygroscopic, organic-soluble reagent used as a nucleophilic
fluoride source in Nucleophilic Fluorination and Allylation Reactions. |  | Preparation | Tetrabutylammonium Difluorotriphenylsilicate is prepared by treatment of triphenylsilyl fluoride
with tetrabutylammonium fluoride (TBAF), or by reaction
of triphenylsilane with tetrabutylammonium hydrogen
difluoride. | 
|  |  | Tetrabutylammonium Difluorotriphenylsilicate Preparation Products And Raw materials | 
 |