|
| Product Name: | Ostarine(MK-2866) | | Synonyms: | (2S)-3-(4-Cyanophenoxy-2,3,5,6-d4)-N-[4-cyano-3-(trifluoromethyl)phenyl]-2-hydroxy-2-methylpropanamide;((2s)-3-(4-cyanophenoxy)-N-[4-cyano-3-(trifluoroMethyl)phenyl]-2-hydroxy-2-MethylpropanaMide);(2S)-3-(4-cyano-2,3,5,6-tetradeuteriophenoxy)-N-[4-cyano-3-(trifluoromethyl)phenyl]-2-hydroxy-2-methylpropanamide;MK-2866 MK-2866 White powder 99%;Factory Supply best quality Ostarine(MK-2866) 1202044-20-9 CAS NO.1202044-20-9;Ostarine(MK-2866),mk2866,mk 2866;MK-2866 mk2866 OSTARINE CAS NO.1202044-20-9 CAS NO. 1202044-20-9 Supplier;Ostarine (MK-2866, GTx-024) | | CAS: | 1202044-20-9 | | MF: | C19H14F3N3O3 | | MW: | 389.33 | | EINECS: | 206-141-6 | | Product Categories: | 1202044-20-9 | | Mol File: | 1202044-20-9.mol |  |
| | Ostarine(MK-2866) Chemical Properties |
| storage temp. | -20°C | | solubility | DMF: soluble,DMSO: soluble,Methanol: soluble | | form | A solid | | InChI | InChI=1/C19H14F3N3O3/c1-18(27,11-28-15-6-2-12(9-23)3-7-15)17(26)25-14-5-4-13(10-24)16(8-14)19(20,21)22/h2-8,27H,11H2,1H3,(H,25,26)/t18-/s3 | | InChIKey | JNGVJMBLXIUVRD-ZAWDOUAYNA-N | | SMILES | C(C1C=C(NC(=O)[C@](O)(C)COC2C([H])=C([H])C(C#N)=C([H])C=2[H])C=CC=1C#N)(F)(F)F |&1:7,r| |
| | Ostarine(MK-2866) Usage And Synthesis |
| Use | Ostarine, also known as ostarine MK-2866, is an investigational selective androgen receptor modulator (SARM) developed by GTx, Inc. for the treatment of conditions such as muscle wasting and osteoporosis. | | Mechanism | Ostarine(MK-2866) attaches to proteins in the body known as androgen receptors. When ostarine binds to these receptors, it tells the muscles in the body to grow. Unlike some other chemicals that bind to androgen receptors, such as steroids, ostarine doesn't seem to cause as many side effects in other parts of the body. | | Health effects | The FDA have warned that SARMs can have serious side effects ranging from risk of heart attack to stroke and liver damage. | | Description | Ostarine is an investigational drug that has not yet been approved by the US Food and Drug Administration (FDA). It is part of a class of drugs called selective androgen receptor modulators (SARMs). | | Uses | (2S)-3-(4-Cyanophenoxy-2,3,5,6-d4)-N-[4-cyano-3-(trifluoromethyl)phenyl]-2-hydroxy-2-methylpropanamide is a metabolites of selective androgen receptor modulators (SARM). |
| | Ostarine(MK-2866) Preparation Products And Raw materials |
|