|
| | L-CYSTINE DIHYDROCHLORIDE Basic information |
| | L-CYSTINE DIHYDROCHLORIDE Chemical Properties |
| Melting point | 228-232℃ | | alpha | [α]D20 -165~-175° (c=1, dil. HCl) | | density | 1.518[at 20℃] | | vapor pressure | 0Pa at 20℃ | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | 0.5 M HCl: 50 mg/mL | | form | Powder | | color | White to Pale Yellow | | Odor | odorless | | Water Solubility | Soluble in hydrochloric acid. (0.5 M HCl: 50 mg/mL) Soluble in water. | | InChI | InChI=1/C6H12N2O4S2.ClH/c7-3(5(9)10)1-13-14-2-4(8)6(11)12;/h3-4H,1-2,7-8H2,(H,9,10)(H,11,12);1H/t3-,4-;/s3 | | InChIKey | IOCJWNPYGRVHLN-QYDODFSFNA-N | | SMILES | [C@@H](N)(C(=O)O)CSSC[C@H](N)C(=O)O.Cl |&1:0,9,r| | | LogP | -5.08 at 25℃ | | CAS DataBase Reference | 30925-07-6(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | TSCA | Yes | | HS Code | 29309013 |
| | L-CYSTINE DIHYDROCHLORIDE Usage And Synthesis |
| Chemical Properties | Solid | | Uses | L-Cystine is a sulfur containing non-essential amino acid. It is used as a cell culture media component and raw material in the commercial biomanufacture of therapeutic recombinant proteins and monoclonal antibodies. L-Cystine dihydrochloride is a modified version of L-Cystine with improved solubility. | | Flammability and Explosibility | Notclassified | | Biochem/physiol Actions | L-Cystine is a natural proteinogenic amino acid sulfide dimer of L-cysteine. L-cystine is used as a cell culture supplement. L-cystine is also used to characterize and identify specific amino acid transport systems in cells such as system system Xc(─) . |
| | L-CYSTINE DIHYDROCHLORIDE Preparation Products And Raw materials |
|