|
| | 2-bromo-4-chloropropiophenone Basic information |
| Product Name: | 2-bromo-4-chloropropiophenone | | Synonyms: | 2-bromo-4-chloropropiophenone;2-Bromo-1-(4-chloro-phenyl)-propan-1-one, 2-Бром-1-(4-хлорфенил)-пропан-1-он, 2-bromo-4'-chloropropiophenone;1-Propanone, 2-bromo-1-(4-chlorophenyl)-;2-Bromo-1-(4-chlorophenyl)-1-propanone;Bupropion Impurity 32;(2R)-2-bromo-1-(4-chlorophenyl)propan-1-one | | CAS: | 877-37-2 | | MF: | C9H8BrClO | | MW: | 247.52 | | EINECS: | 100-413-0 | | Product Categories: | | | Mol File: | 877-37-2.mol |  |
| | 2-bromo-4-chloropropiophenone Chemical Properties |
| Melting point | 77-79 °C(Solv: ligroine (8032-32-4)) | | Boiling point | 296.7±15.0 °C(Predicted) | | density | 1.518±0.06 g/cm3(Predicted) | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | color | Off-White to Pale Beige | | InChI | InChI=1S/C9H8BrClO/c1-6(10)9(12)7-2-4-8(11)5-3-7/h2-6H,1H3 | | InChIKey | SAKMPXRILWVZEG-UHFFFAOYSA-N | | SMILES | C(C1=CC=C(Cl)C=C1)(=O)C(Br)C |
| | 2-bromo-4-chloropropiophenone Usage And Synthesis |
| Uses | 2-bromo-4-chloropropiophenone can be used as an intermediate in organic synthesis, mainly used in laboratory research and development and chemical production processes. | | Synthesis | A solution of 15.9 g (0.1 mol) of bromine in 20 ml of chloroform is added dropwise to a solution of 16.8 g (0.1 mol) of 4'-chloropropiophenone in 100 ml of chloroform, in the presence of a small amount of aluminium chloride, and the mixture is stirred overnight. After filtration and evaporation of the filtrate, the crystalline residue is washed with petroleum ether. When dry, it melts at 75° C. |
| | 2-bromo-4-chloropropiophenone Preparation Products And Raw materials |
|