|
| | 4-(DIMETHYLAMINO)BENZONITRILE Basic information |
| | 4-(DIMETHYLAMINO)BENZONITRILE Chemical Properties |
| Melting point | 72-75 °C(lit.) | | Boiling point | 318 °C(lit.) | | density | 1.3346 (rough estimate) | | refractive index | 1.5600 (estimate) | | Fp | 317-319°C | | solubility | soluble in Methanol | | pka | 1.61±0.12(Predicted) | | form | Crystalline Powder | | color | Light brown | | BRN | 971606 | | InChI | InChI=1S/C9H10N2/c1-11(2)9-5-3-8(7-10)4-6-9/h3-6H,1-2H3 | | InChIKey | JYMNQRQQBJIMCV-UHFFFAOYSA-N | | SMILES | C(#N)C1=CC=C(N(C)C)C=C1 | | CAS DataBase Reference | 1197-19-9(CAS DataBase Reference) | | EPA Substance Registry System | Benzonitrile, 4-(dimethylamino)- (1197-19-9) |
| | 4-(DIMETHYLAMINO)BENZONITRILE Usage And Synthesis |
| Chemical Properties | light brown crystalline powder | | Uses | 4-(Dimethylamino)benzonitrile is used in predicting the carcinogenicity of aromatic amine derivative in UK EMS collaborative study. | | Uses | 4-(Dimethylamino)benzonitrile can be used in the synthesis of 3,6-diphenyl-2,5-dihydro-pyrrolo[3,4-c]pyrrole-1,4-dione derivatives. | | Synthesis Reference(s) | Tetrahedron Letters, 36, p. 4035, 1995 DOI: 10.1016/0040-4039(95)00710-T | | General Description | 4-(Dimethylamino)benzonitrile is extensively used in photophysical studies due to its ability to undergo intramolecular charge transfer (ICT) from the dimethylamino moiety to the cyanophenyl moiety on photo-excitation leading to the appearance of dual fluorescence. |
| | 4-(DIMETHYLAMINO)BENZONITRILE Preparation Products And Raw materials |
|