|
| | Octafluoronaphthalene Basic information |
| Product Name: | Octafluoronaphthalene | | Synonyms: | 1,2,3,4,5,6,7,8-Octafluoronaphthalene;Naphthalene, octafluoro-;naphthalene,octafluoro-;PERFLUORONAPHTHALENE;OCTAFLUORONAPHTHALENE;AKOS MSC-0224;Octafluoronaphthalene,97%;Octafluoronaphthalene 95% | | CAS: | 313-72-4 | | MF: | C10F8 | | MW: | 272.09 | | EINECS: | 206-239-9 | | Product Categories: | Aryl;C9 to C12;Halogenated Hydrocarbons | | Mol File: | 313-72-4.mol |  |
| | Octafluoronaphthalene Chemical Properties |
| Melting point | 87-88 °C (lit.) | | Boiling point | 80°C 15mm | | density | 1.4296 (rough estimate) | | refractive index | 1.367 | | Fp | 80°C/15mm | | storage temp. | Sealed in dry,Room Temperature | | form | Crystals or Needles | | color | White | | Water Solubility | Insoluble in water. Solubility in toluene, almost transparent. | | BRN | 1915630 | | InChI | InChI=1S/C10F8/c11-3-1-2(5(13)9(17)7(3)15)6(14)10(18)8(16)4(1)12 | | InChIKey | JDCMOHAFGDQQJX-UHFFFAOYSA-N | | SMILES | C1(F)=C2C(C(F)=C(F)C(F)=C2F)=C(F)C(F)=C1F | | CAS DataBase Reference | 313-72-4(CAS DataBase Reference) | | NIST Chemistry Reference | Perfluoronaphthalene(313-72-4) | | EPA Substance Registry System | Octafluoronaphthalene (313-72-4) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 9-29-36-36/37 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29039990 |
| | Octafluoronaphthalene Usage And Synthesis |
| Chemical Properties | WHITE CRYSTALS OR NEEDLES | | Uses | It is a important organic intermediate. It can be used in agrochemical, pharmaceutical and dyestuff field. |
| | Octafluoronaphthalene Preparation Products And Raw materials |
|
