|
| | Loxoprofen Basic information |
| Product Name: | Loxoprofen | | Synonyms: | 2-[4-[(2-Oxocyclopentan-1-yl)methyl]phenyl]propionic acid;KOLOXO;LOXOPROFEN;α-methyl-4-[(2-oxocyclopentyl)methyl]benzeneacetic acid;ALPHA-METHYL-4-[(2-OXOCYCLOPENTYL)METHYL]BENZENEACETIC ACID;Benzeneacetic acid, a-methyl-4-[(2-oxocyclopentyl)methyl]- (9CI);Loxoprofen (base and/or unspecified salts);α-Methyl-4-[(2-oxocyclopentyl)methyl]benzeneacetic acid, Koloxo | | CAS: | 68767-14-6 | | MF: | C15H18O3 | | MW: | 246.31 | | EINECS: | 1806241-263-5 | | Product Categories: | LOXONIN;Active Pharmaceutical Ingredients | | Mol File: | 68767-14-6.mol |  |
| | Loxoprofen Chemical Properties |
| Melting point | 108.5-111° | | Boiling point | bp0.3 190-195° | | density | 1.182±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | solid | | pka | 4.39±0.10(Predicted) | | color | White to Off-White | | Merck | 14,5589 | | InChI | InChI=1S/C15H18O3/c1-10(15(17)18)12-7-5-11(6-8-12)9-13-3-2-4-14(13)16/h5-8,10,13H,2-4,9H2,1H3,(H,17,18) | | InChIKey | YMBXTVYHTMGZDW-UHFFFAOYSA-N | | SMILES | C(C1CCCC1=O)C1C=CC(C(C)C(=O)O)=CC=1 | | CAS DataBase Reference | 68767-14-6(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 2918.99.3000 |
| | Loxoprofen Usage And Synthesis |
| Uses | antiinflammatory, analgesic | | Uses | Loxoprofen is a non-selective nonsteroidal anti-inflammatory drug (NSAID) that has been effective in reducing atherosclerosis in mice by reducing inflammation. Loxoprofen becomes active after metabolism in the body and inhibits the activation of cyclooxygenase. | | Definition | ChEBI: A monocarboxylic acid that is propionic acid in which one of the hydrogens at position 2 is substituted by a 4-[(2-oxocyclopentyl)methyl]phenyl group. A prodrug that is rapidly converted to its active trans-alcohol metabolite following ora
administration. |
| | Loxoprofen Preparation Products And Raw materials |
|
