| 
 |  | 1,4-Dibenzyloxybenzene Basic information |  
  
 |  | 1,4-Dibenzyloxybenzene Chemical Properties |  
 | Melting point  | 128°C |  | Boiling point  | 441.7±25.0 °C(Predicted) |  | density  | 1.121±0.06 g/cm3(Predicted) |  | storage temp.  | Sealed in dry,Room Temperature |  | form  | powder to crystal |  | color  | White to Light yellow |  | BRN  | 2058196 |  | InChI | InChI=1S/C20H18O2/c1-3-7-17(8-4-1)15-21-19-11-13-20(14-12-19)22-16-18-9-5-2-6-10-18/h1-14H,15-16H2 |  | InChIKey | DYULYMCXVSRUPB-UHFFFAOYSA-N |  | SMILES | C1(OCC2=CC=CC=C2)=CC=C(OCC2=CC=CC=C2)C=C1 |  | CAS DataBase Reference | 621-91-0(CAS DataBase Reference) |  | NIST Chemistry Reference | 1,4-Dibenzyloxybenzene(621-91-0) |  
  
| Safety Statements  | 22-24/25 |  | HS Code  | 29093090 |  
  
| Provider | Language | 
 
| 
ALFA
 | English | 
 
 
 
 
 |  | 1,4-Dibenzyloxybenzene Usage And Synthesis |  
 | Chemical Properties | Tan powder. Purity 90%
(min). Insoluble in water; soluble in acetone, benzene, and chlorobenzene. Combustible. |  | Uses | 1,4-Dibenzyloxybenzene is a medium-strength rubber anti-aging agent, non-polluting, and does not change color under long-term sunlight exposure. Mainly used in the manufacture of sponge rubber products.
 |  | Preparation | 1,4-Bis(benzyloxy)benzene is synthesized by the reaction of hydroquinone and benzyl chloride. |  
  
 |  | 1,4-Dibenzyloxybenzene Preparation Products And Raw materials |  
  
 
 |