|
| | 1,2-HEXADECANEDIOL Basic information |
| | 1,2-HEXADECANEDIOL Chemical Properties |
| Melting point | 68-72 °C (lit.) | | Boiling point | 310.3°C (rough estimate) | | density | 0.8878 (rough estimate) | | refractive index | 1.4731 (estimate) | | Fp | 183 °C | | pka | 14.45±0.20(Predicted) | | form | powder to crystal | | color | White to Almost white | | BRN | 1722206 | | Stability: | Stable. Incompatible with strong oxidizing agents. | | InChI | InChI=1S/C16H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16(18)15-17/h16-18H,2-15H2,1H3 | | InChIKey | BTOOAFQCTJZDRC-UHFFFAOYSA-N | | SMILES | C(O)C(O)CCCCCCCCCCCCCC | | LogP | 5.615 (est) | | EPA Substance Registry System | 1,2-Hexadecanediol (6920-24-7) |
| Safety Statements | 22-24/25 | | WGK Germany | 1 | | HS Code | 29053990 |
| | 1,2-HEXADECANEDIOL Usage And Synthesis |
| Chemical Properties | beige powder | | Uses | 1,2-Hexadecanediol was used as reducing agent in the preparation of silver nanocrystals from a dichlorobenzene solution containing oleyl amine as a surfactant. It was also used in the preparation of:
- Au-Fe3O4 hetero-dimers
- iron pyrite nanocrystals
- monodisperse iron platinum nanoparticles
| | Definition | ChEBI: A glycol that is hexadecane which is substituted by hydroxy groups at positions 1 and 2. |
| | 1,2-HEXADECANEDIOL Preparation Products And Raw materials |
|