|
| | Levodropropizine Basic information |
| | Levodropropizine Chemical Properties |
| Melting point | 98-100°C | | Boiling point | 412.7±34.0 °C(Predicted) | | density | 1.168±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | Slightly soluble in water, freely soluble in dilute acetic acid and in methanol, slightly soluble in ethanol (96 per cent). | | pka | 14.21±0.20(Predicted) | | form | neat | | color | White to Almost white | | InChI | InChI=1S/C13H20N2O2/c16-11-13(17)10-14-6-8-15(9-7-14)12-4-2-1-3-5-12/h1-5,13,16-17H,6-11H2/t13-/m0/s1 | | InChIKey | PTVWPYVOOKLBCG-ZDUSSCGKSA-N | | SMILES | C(O)[C@@H](O)CN1CCN(C2=CC=CC=C2)CC1 | | CAS DataBase Reference | 99291-25-5(CAS DataBase Reference) |
| | Levodropropizine Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | S-Form of Dropropizine. Cough suppressive phenylpiperazine derivative. Antitussive. | | Uses | Cough Suppressant | | Definition | ChEBI: A member of the class of N-arylpiperazines that is N-phenylpiperazine in which the amino hydrogen is replaced by a 2,3-dihydroxypropyl group (the S-enantiomer). A peripherally acting antitussive drug t
at is used as an alternative to opioids. |
| | Levodropropizine Preparation Products And Raw materials |
|