|
| | Hydroxyprogesterone acetate Basic information |
| Product Name: | Hydroxyprogesterone acetate | | Synonyms: | Chlormadinone acetate impurity G;17a- hydroxyprogesterone acetate (monoester);(8S,9S,10R,13S,14S,17S)-17-Acetyl-10,13-dimethyl-3-oxo-2,3,6,7,8,9,10,11,12,13,14,15,16,17-tet;17A-HYDROXYPROGESTERONE 17-ACETATE VETRA;17-alpha-Hydroxylprogesterone;17α-acetoxy-4-pregnene-3,20-dione;HYDROXYPROGESTERONE, 17a-(RG);17a-Hydroxy-4-pregnene-3,20-dione acetate | | CAS: | 302-23-8 | | MF: | C23H32O4 | | MW: | 372.5 | | EINECS: | 206-119-6 | | Product Categories: | Impurities;Intermediates & Fine Chemicals;Pharmaceuticals;API;Steroids;302-23-8 | | Mol File: | 302-23-8.mol |  |
| | Hydroxyprogesterone acetate Chemical Properties |
| Melting point | 249-250°C | | Boiling point | 421.94°C (rough estimate) | | density | 1.0415 (rough estimate) | | refractive index | 1.4433 (estimate) | | storage temp. | Sealed in dry,2-8°C | | solubility | Chloroform (Sparingly), Ethyl Acetate (Slightly), Methanol (Sparingly) | | form | neat | | Water Solubility | 1.01mg/L at 20℃ | | λmax | 241nm(EtOH)(lit.) | | BRN | 2227870 | | InChI | InChI=1S/C23H32O4/c1-14(24)23(27-15(2)25)12-9-20-18-6-5-16-13-17(26)7-10-21(16,3)19(18)8-11-22(20,23)4/h13,18-20H,5-12H2,1-4H3/t18-,19+,20+,21+,22+,23+/m1/s1 | | InChIKey | VTHUYJIXSMGYOQ-KOORYGTMSA-N | | SMILES | C1(=O)C=C2[C@](C)(CC1)[C@]1([H])[C@]([H])([C@@]3([H])[C@@](CC1)(C)[C@@](OC(C)=O)(C(=O)C)CC3)CC2 | | CAS DataBase Reference | 302-23-8(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 40-48 | | Safety Statements | 22-24/25-45 | | RIDADR | UN 2811 6.1/PG 2 | | WGK Germany | 3 | | RTECS | TU5074000 | | HS Code | 29372390 |
| | Hydroxyprogesterone acetate Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | An impurity in steroid drug Megestrol acetate (M208050). | | Uses | Progesterone Acetate (Megestrol Acetate EP Impurity K) is an impurity in steroid drug Megestrol acetate (M208050). |
| | Hydroxyprogesterone acetate Preparation Products And Raw materials |
|