|
| | DMT-dG(ib) Phosphoramidite Basic information |
| Product Name: | DMT-dG(ib) Phosphoramidite | | Synonyms: | dG(N-ibu) Phosphoramidite;N-blocked-5'-O-DMT 3'-CED deoxyguanosine phosphoramidite;5'-O-(4,4-Dimethoxytrityl)-N-isobutyryl-2'-deoxyguanosine-3'-(2-cyanoethyl-N,N-diisopropyl)phosphoramidite;5'-O-(4,4'-DIMETHOXYTRITYL)-N2-ISOBUTYRYL-2'-DEOXYGUANOSINE-3'-(2-CYANOETHYL-N,N-DIISOPROPYL)PHOSPHORAMIDITE;N2-(ISOBUTYRYL)-5'-O-(DIMETHOXYTRITYL)-2'-DEOXYGUANOSINE-3'-N,N-DIISOPROPYL (CYANOETHYL) PHOSPHORAMIDITE;deoxyguanosine-ce phosphoramidite*for cyclone;DNA G Phosphoramidite;DMT-dG(dmf) Amidite 5g, Single | | CAS: | 93183-15-4 | | MF: | C44H54N7O8P | | MW: | 839.92 | | EINECS: | 685-519-6 | | Product Categories: | Pharmaceutical;RNAi | | Mol File: | 93183-15-4.mol |  |
| | DMT-dG(ib) Phosphoramidite Chemical Properties |
| density | 1.22 at 20℃ | | vapor pressure | 0-0Pa at 20-50℃ | | storage temp. | Sealed in dry,2-8°C | | solubility | soluble, clear | | pka | 9.16±0.20(Predicted) | | form | powder or granules | | color | white to off-white | | InChIKey | FDRMKYVTIFSDPR-MMROLVBFSA-N | | SMILES | C(OC[C@H]1O[C@@H](N2C=NC3C(=O)NC(NC(=O)C(C)C)=NC2=3)C[C@@H]1OP(OCCC#N)N(C(C)C)C(C)C)(C1=CC=CC=C1)(C1=CC=C(OC)C=C1)C1=CC=C(OC)C=C1 |&1:3,5,23,r| | | LogP | 4.17 at 20℃ |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29349990 |
| | DMT-dG(ib) Phosphoramidite Usage And Synthesis |
| Uses | 2’-Deoxy-5’-O-DMT-N2-isobutyrylguanosine 3’-CE Phosphoramidite is used to prepare antisense oligonucleotides containing conformationally constrained methoxyaminomethylene and aminooxymethylene and aminomethylene bridged nucleoside analogs. |
| | DMT-dG(ib) Phosphoramidite Preparation Products And Raw materials |
|