|
| | 17a-Methyl-1-testosterone Basic information |
| | 17a-Methyl-1-testosterone Chemical Properties |
| Melting point | 162-168 °C(lit.) | | Boiling point | 422.7±45.0 °C(Predicted) | | density | 1.082 | | solubility | H2O: ≤0.5 mg/mL | | form | solid (photosensitive) | | pka | 15.14±0.60(Predicted) | | color | white | | InChI | InChI=1/C20H30O2/c1-18-9-6-14(21)12-13(18)4-5-15-16(18)7-10-19(2)17(15)8-11-20(19,3)22/h6,9,13,15-17,22H,4-5,7-8,10-12H2,1-3H3/t13-,15+,16-,17-,18-,19-,20-/s3 | | InChIKey | JRNSSSJKIGAFCT-PHHVUGHDNA-N | | SMILES | [C@@]12([H])CC[C@@]3([H])CC(=O)C=C[C@]3(C)[C@@]1([H])CC[C@]1(C)[C@](CC[C@@]21[H])(O)C |&1:0,4,11,13,17,19,22,r| | | CAS DataBase Reference | 65-04-3(CAS DataBase Reference) |
| Hazard Codes | T | | Risk Statements | 45-63 | | Safety Statements | 53-36/37-45 | | WGK Germany | 3 | | RTECS | BV8400000 | | DEA Controlled Substances | CSCN: 4000 CSA SCH: Schedule III NARC: No |
| | 17a-Methyl-1-testosterone Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | Methyl-1-Testosterone is a derivative of dihydrotestosterone. Methyl-1-Testosterone is a designer anabolic steroid that is on the world anti-doping agency’s (WADA) prohibited list. |
| | 17a-Methyl-1-testosterone Preparation Products And Raw materials |
|