|
| | 3,4-Dihydroxybenzonitrile Basic information |
| | 3,4-Dihydroxybenzonitrile Chemical Properties |
| Melting point | 155-159 °C (lit.) | | Boiling point | 334.8±32.0 °C(Predicted) | | density | 1.42±0.1 g/cm3(Predicted) | | vapor pressure | 0Pa at 20℃ | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 7.67±0.18(Predicted) | | color | White to Almost white | | Water Solubility | insoluble | | BRN | 2082204 | | InChI | InChI=1S/C7H5NO2/c8-4-5-1-2-6(9)7(10)3-5/h1-3,9-10H | | InChIKey | NUWHYWYSMAPBHK-UHFFFAOYSA-N | | SMILES | C(#N)C1=CC=C(O)C(O)=C1 | | LogP | 1.3 at 20℃ | | CAS DataBase Reference | 17345-61-8(CAS DataBase Reference) |
| | 3,4-Dihydroxybenzonitrile Usage And Synthesis |
| Chemical Properties | Off-white powder | | General Description | 3,4-Dihydroxybenzonitrile can be prepared from 4-hydroxy-3-methoxybenzonitrile. It can also be synthesized by reacting 3,4-dimethoxybenzonitrile, lithium diisopropylamide (LDA) and 1,3-dimethyl-2-imidazolidinone (DMEU). |
| | 3,4-Dihydroxybenzonitrile Preparation Products And Raw materials |
|