|
| | alpha-(Methylaminomethyl)benzyl alcohol Basic information |
| Product Name: | alpha-(Methylaminomethyl)benzyl alcohol | | Synonyms: | (+-)-alpha-((methylamino)methyl)benzenemethanol;dl-1-phenyl-1-oxy-2-(methylamino)-aethan;dl-benzylalcoho;HALOSTACHINE;DL-ALPHA-(METHYLAMINOMETHYL)BENZYL ALCOHOL;2-METHYLAMINO-1-PHENYLETHANOL;ALPHA-(METHYLAMINOMETHYL)BENZYL ALCOHOL;N-METHYLPHENYLETHANOLAMINE | | CAS: | 68579-60-2 | | MF: | C9H13NO | | MW: | 151.21 | | EINECS: | 218-689-3 | | Product Categories: | | | Mol File: | 68579-60-2.mol |  |
| | alpha-(Methylaminomethyl)benzyl alcohol Chemical Properties |
| Melting point | 74-76 °C(lit.) | | Boiling point | 273.23°C (rough estimate) | | density | 1.0406 (rough estimate) | | refractive index | 1.5380 (estimate) | | storage temp. | -20°C, Inert atmosphere | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | InChI | InChI=1S/C9H13NO/c1-10-7-9(11)8-5-3-2-4-6-8/h2-6,9-11H,7H2,1H3 | | InChIKey | ZCTYHONEGJTYQV-UHFFFAOYSA-N | | SMILES | C(O)(CNC)C1=CC=CC=C1 |
| Hazard Codes | Xn | | Risk Statements | 20/22 | | Safety Statements | 36 | | WGK Germany | 3 | | RTECS | DO9625000 |
| | alpha-(Methylaminomethyl)benzyl alcohol Usage And Synthesis |
| Chemical Properties | WHITE FINE CRYSTALLINE NEEDLES | | Uses | α-(Methylaminomethyl)benzyl alcohol was used in the synthesis of 1,4-disubstituted-2,3,4,5-tetrahydro-1H-3-benzazepines. It was also used as internal standard during determination of pseudoephedrine and phenylpropanolamine urine concentrations by HPLC. And 2-(Methylamino)-1-phenylethanol is a reagent used in the synthesis of novel hydrazine inhibitors for human vascular adhesion protein-1. | | Definition | ChEBI: alpha-(Methylaminomethyl)benzyl alcohol is an alkaloid that is ethanolamine having the phenyl group at the 1-position and a methyl group attached to the nitrogen. It has been isolated from Halostachys caspica. It has a role as a human metabolite and a plant metabolite. It is an alkaloid and a member of phenylethanolamines. It is a conjugate base of a N-methylphenylethanolaminium. | | Synthesis Reference(s) | Journal of the American Chemical Society, 102, p. 7125, 1980 DOI: 10.1021/ja00543a051
The Journal of Organic Chemistry, 49, p. 4107, 1984 DOI: 10.1021/jo00196a001 |
| | alpha-(Methylaminomethyl)benzyl alcohol Preparation Products And Raw materials |
|
