| 
 |  | 5-METHYLAMINO-[1,3,4]THIADIAZOLE-2-THIOL Basic information |  
 | Product Name: | 5-METHYLAMINO-[1,3,4]THIADIAZOLE-2-THIOL |  | Synonyms: | 1,3,4-Thiadiazole-2(3H)-thione, 5-(methylamino)-;5-Mercapto-2-methylamino-1,3,4-thiadiazole;5-methylamino-3H-1,3,4-thiadiazole-2-thione;InChI=1/C3H5N3S2/c1-4-2-5-6-3(7)8-2/h1H3,(H,4,5)(H,6,7;5-METHYLAMINO-[1,3,4]THIADIAZOLE-2-THIOL;TIMTEC-BB SBB010147;5-(methylamino)-1,3,4-thiadiazole-2(3H)-thione;1,3,4-Thiadiazole-2(3H)-thione,5-(methylamino)-(9CI) |  | CAS: | 27386-01-2 |  | MF: | C3H5N3S2 |  | MW: | 147.22 |  | EINECS: | 248-436-2 |  | Product Categories: | THIOL |  | Mol File: | 27386-01-2.mol |  ![5-METHYLAMINO-[1,3,4]THIADIAZOLE-2-THIOL Structure](CAS/GIF/27386-01-2.gif)  |  
  
 |  | 5-METHYLAMINO-[1,3,4]THIADIAZOLE-2-THIOL Chemical Properties |  
  
| Hazard Codes  | Xi |  | HazardClass  | IRRITANT |  | HS Code  | 2934999090 |  
  
 |  | 5-METHYLAMINO-[1,3,4]THIADIAZOLE-2-THIOL Usage And Synthesis |  
 | Definition | ChEBI: 5-(methylamino)-3H-1,3,4-thiadiazole-2-thione is a secondary amine. |  | Synthesis Reference(s) | Journal of the American Chemical Society, 78, p. 4649, 1956 DOI: 10.1021/ja01599a033 |  
  
 |  | 5-METHYLAMINO-[1,3,4]THIADIAZOLE-2-THIOL Preparation Products And Raw materials |  
  
 
 |