|  | |  |  | 2-Aminoacetophenone hydrochloride Basic information | 
|  |  | 2-Aminoacetophenone hydrochloride Chemical Properties | 
 | Melting point | 194 °C (dec.)(lit.) |  | storage temp. | Refrigerator (+4°C) |  | solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) |  | form | Crystals |  | color | Slightly yellow to beige |  | BRN | 3563173 |  | Stability: | Hygroscopic |  | InChI | InChI=1S/C8H9NO.ClH/c9-6-8(10)7-4-2-1-3-5-7;/h1-5H,6,9H2;1H |  | InChIKey | CVXGFPPAIUELDV-UHFFFAOYSA-N |  | SMILES | C(C1=CC=CC=C1)(=O)CN.[H]Cl |  | CAS DataBase Reference | 5468-37-1(CAS DataBase Reference) |  | EPA Substance Registry System | Ethanone, 2-amino-1-phenyl-, hydrochloride (5468-37-1) | 
| Hazard Codes | Xi |  | Risk Statements | 36/37/38 |  | Safety Statements | 37/39-26-24/25 |  | WGK Germany | 3 |  | RTECS | AM5940000 |  | TSCA | Yes |  | HazardClass | IRRITANT |  | HS Code | 29223990 | 
|  |  | 2-Aminoacetophenone hydrochloride Usage And Synthesis | 
 | Chemical Properties | Off-white crystalline |  | Uses | Mixed Salt of α-Aminoacetophenone, used in the preparation og pseudopeptidic inhibitors of human sirtuins1-3. This action effectually displays antiproliferative protperties in cancer cells. Also used in the preparation of dual δ/μopiod receptor agonists. |  | Purification Methods | Crystallise the salt from Me2CO /EtOH, EtOH/ Et2O, 2-propanol or 2-propanol and a little HCl (slowly after a fe | 
|  |  | 2-Aminoacetophenone hydrochloride Preparation Products And Raw materials | 
 |