|
| | N-FORMYL-L-LEUCINE Basic information |
| | N-FORMYL-L-LEUCINE Chemical Properties |
| Melting point | 142 °C | | Boiling point | 284.67°C (rough estimate) | | density | 1.2013 (rough estimate) | | refractive index | -39.5 ° (C=1, H2O) | | storage temp. | -20°C | | solubility | Ethanol (Sparingly), Methanol (Slightly) | | form | powder | | pka | 3.51±0.21(Predicted) | | color | white | | Water Solubility | 29.45g/L(temperature not stated) | | InChI | InChI=1S/C7H13NO3/c1-5(2)3-6(7(10)11)8-4-9/h4-6H,3H2,1-2H3,(H,8,9)(H,10,11)/t6-/m0/s1 | | InChIKey | HFBHOAHFRNLZGN-LURJTMIESA-N | | SMILES | C(O)(=O)[C@H](CC(C)C)NC=O | | CAS DataBase Reference | 6113-61-7(CAS DataBase Reference) |
| WGK Germany | 1 | | HazardClass | IRRITANT | | HS Code | 2924297099 |
| | N-FORMYL-L-LEUCINE Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | A synthetic substrate of the lipase inhibitor lipstatin. |
| | N-FORMYL-L-LEUCINE Preparation Products And Raw materials |
|