|
| | (S)-3-(Allylsulphinyl)-L-alanine Basic information |
| | (S)-3-(Allylsulphinyl)-L-alanine Chemical Properties |
| Melting point | 164-166° (effervescence) | | alpha | D20 +63.5° (c = 2) | | Boiling point | 416.1±45.0 °C(Predicted) | | density | 1.205 (estimate) | | refractive index | 1.5500 (estimate) | | storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | pka | 1.88±0.10(Predicted) | | form | solid | | Merck | 13,259 | | InChI | InChI=1/C6H11NO3S/c1-2-3-11(10)4-5(7)6(8)9/h2,5H,1,3-4,7H2,(H,8,9)/t5-,11-/s3 | | InChIKey | XUHLIQGRKRUKPH-DYEAUMGKSA-N | | SMILES | C(O)(=O)[C@H](C[S@](CC=C)=O)N |&1:3,5,r| | | LogP | -0.478 (est) | | CAS DataBase Reference | 556-27-4(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | F | 8-10 | | HS Code | 29309090 |
| | (S)-3-(Allylsulphinyl)-L-alanine Usage And Synthesis |
| Uses | antibacterial, antioxidant | | Definition | ChEBI: An L-alanine derivative in which one of the methyl hydrogens of L-alanine has been replaced by an (S)-allylsulfinyl group. | | target | PPAR | TNF-α | IL Receptor | NF-kB | SOD | NADPH-oxidase | ROS |
| | (S)-3-(Allylsulphinyl)-L-alanine Preparation Products And Raw materials |
|