|
| | 1-Bromo-3,5-dimethyladamantane Basic information | | Uses |
| Product Name: | 1-Bromo-3,5-dimethyladamantane | | Synonyms: | 1-Bromo-3,5-dimethyltricyclo[3.3.1.13,7]decane;1-BROMO-3,5-DIMETHYLADAMANTANE;3,5-dimethyl-1-bromo- adamantane;1-Bromo-3,5-Dimethyl;1,3-Dimethyl-5-bromoadamantane;tricyclo[3.3.1.1~3,7~]decane, 1-bromo-3,5-dimethyl-;NSC 102293;1-BROMO-3,5- DIMETHYL DAMANTANE | | CAS: | 941-37-7 | | MF: | C12H19Br | | MW: | 243.18 | | EINECS: | 213-378-9 | | Product Categories: | Adamantane derivatives;Adamantanes;Alkyl;Halogenated Hydrocarbons;Organic Building Blocks;Intermediates & Fine Chemicals;Chemical intermediate for Memantine HCl;Pharmaceuticals;bc0001;941-37-7 | | Mol File: | 941-37-7.mol |  |
| | 1-Bromo-3,5-dimethyladamantane Chemical Properties |
| Boiling point | 201 °C (lit.) | | density | 1.224 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.52(lit.) | | Fp | 228 °F | | storage temp. | 2-8°C | | solubility | Chloroform (Sparingly), Dichloromethane (Slightly), Methanol (Slightly) | | form | Oil | | Specific Gravity | 1.224 | | color | Colourless to Pale Yellow | | BRN | 1927514 | | InChI | InChI=1S/C12H19Br/c1-10-3-9-4-11(2,6-10)8-12(13,5-9)7-10/h9H,3-8H2,1-2H3 | | InChIKey | QUCXLVDIVQWYJR-UHFFFAOYSA-N | | SMILES | C12(Br)CC3(C)CC(CC(C)(C3)C1)C2 | | CAS DataBase Reference | 941-37-7(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 34-36 | | Safety Statements | 26-27-36/37/39-45 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2903890002 |
| | 1-Bromo-3,5-dimethyladamantane Usage And Synthesis |
| Uses | 1-Bromo-3,5-dimethyladamantane (cas# 941-37-7) is a compound useful in organic synthesis. | | Chemical Properties | Clear Colorless Oil | | Uses | 1-Bromo-3,5-dimethyladamantane was used in the one pot synthesis of 1,3-dicarbonyl adamantanes. It was also used in the synthesis of 3,5-dimethyladamantan-1-ol. |
| | 1-Bromo-3,5-dimethyladamantane Preparation Products And Raw materials |
|
