|
| | 4-(4-Hydroxybutyl)benzoic acid Methyl ester Basic information | | Appearance |
| | 4-(4-Hydroxybutyl)benzoic acid Methyl ester Chemical Properties |
| Boiling point | 343.6±35.0 °C(Predicted) | | density | 1.092±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | | form | Oil | | pka | 15.12±0.10(Predicted) | | color | Colourless to Light Yellow | | InChI | InChI=1S/C12H16O3/c1-15-12(14)11-7-5-10(6-8-11)4-2-3-9-13/h5-8,13H,2-4,9H2,1H3 | | InChIKey | KVKWRSNRAXOBFC-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C1=CC=C(CCCCO)C=C1 |
| | 4-(4-Hydroxybutyl)benzoic acid Methyl ester Usage And Synthesis |
| Appearance | Colourless to light yellow oil | | Uses | 4-(4-Hydroxybutyl)benzoic Acid Methyl Ester is a benzoic acid derivative used in the preparation of yrrolo[2,3-d]pyrimidine-based antitumor agents as well as other biologically active compounds. |
| | 4-(4-Hydroxybutyl)benzoic acid Methyl ester Preparation Products And Raw materials |
|