|
| | cannabichromene Basic information |
| Product Name: | cannabichromene | | Synonyms: | Cannabichromone;Cannabichromene solution;Cannabichromene (CBC);2-methyl-2-(4-methylpent-3-enyl)-7-pentylchromen-5-ol;2-Methyl-2-(4-methyl-3-pentenyl)-7-pentyl-2H-1-benzopyran-5-ol;Cannabichrome;Pentylcannabichromene;cannabichromene | | CAS: | 20675-51-8 | | MF: | C21H30O2 | | MW: | 314.46 | | EINECS: | | | Product Categories: | | | Mol File: | 20675-51-8.mol |  |
| | cannabichromene Chemical Properties |
| Melting point | 145°C | | Boiling point | 394.13°C (rough estimate) | | density | 1.0536 (rough estimate) | | refractive index | 1.5404 (estimate) | | Fp | 9℃ | | storage temp. | -20°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | pka | 9.68±0.40(Predicted) | | form | Oil | | color | Crystals | | InChI | InChI=1S/C21H30O2/c1-5-6-7-10-17-14-19(22)18-11-13-21(4,23-20(18)15-17)12-8-9-16(2)3/h9,11,13-15,22H,5-8,10,12H2,1-4H3 | | InChIKey | UVOLYTDXHDXWJU-UHFFFAOYSA-N | | SMILES | C1(C)(CC/C=C(\C)/C)OC2=CC(CCCCC)=CC(O)=C2C=C1 | | LogP | 8.560 (est) |
| RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution | | WGK Germany | 1 | | HS Code | 9999999999 | | Toxicity | dni-hmn:lyms 100 mmol/L FEPRA7 36,1748,77 |
| | cannabichromene Usage And Synthesis |
| Definition | ChEBI: Cannabichromene is a 1-benzopyran. | | General Description | Cannabichromene (CBC) is a non-psychoactive cannabinoid of Cannabis that reportedly exerts anti-inflammatory, antimicrobial and analgesic activity. This Certified Snap-N-Spike? solution standard is suitable for cannabichromene testing methods by GC/MS, HPLC or LC-MS/MS for Cannabis potency testing or impurity profiling, pharmaceutical research, and forensic analysis. Cerilliant solution Certified Reference Materials (CRMs) of cannabinoids are supplied in a convenient, quantitative, US DEA-exempt solution format and with TK#s for Canadian customers. | | Safety Profile | Poison by intravenous and intraperitoneal routes. Experimental reproductive effects. Mutation data reported. Whenheated to decomposition it emits acrid smoke and irritating fumes | | target | NOS | COX | ERK | ATPase |
| | cannabichromene Preparation Products And Raw materials |
|
