| 
 |  | Diethyl(phenylacetyl)malonate Basic information |  
 | Product Name: | Diethyl(phenylacetyl)malonate |  | Synonyms: | Diethyl(phenylacetyl)malonate;Propanedioic acid, 2-(2-phenylacetyl)-, 1,3-diethyl ester;Propanedioic acid, (phenylacetyl)-, diethyl ester;Pharmaceutical intermediates Diethyl(phenylacetyl)malonate;2-(2-phenylacetyl)propanedioate;White Powder New P Pharmaceutical Grade;Diethyl(phenylacetyl)malonate White Powder;White Powder Diethyl(phenylacetyl)malonate |  | CAS: | 20320-59-6 |  | MF: | C15H18O5 |  | MW: | 278.3 |  | EINECS: | 205-854-1 |  | Product Categories: | 20320-59-6;BMK |  | Mol File: | 20320-59-6.mol |    |  
  
 |  | Diethyl(phenylacetyl)malonate Chemical Properties |  
 | Boiling point  | 120 °C(Press: 0.01 Torr) |  | density  | 1.148±0.06 g/cm3(Predicted) |  | pka | 8.76±0.59(Predicted) |  | InChI | InChI=1S/C15H18O5/c1-3-19-14(17)13(15(18)20-4-2)12(16)10-11-8-6-5-7-9-11/h5-9,13H,3-4,10H2,1-2H3 |  | InChIKey | ZASPDQDIPTZTQQ-UHFFFAOYSA-N |  | SMILES | C(OCC)(=O)C(C(CC1=CC=CC=C1)=O)C(OCC)=O |  
  
 |  | Diethyl(phenylacetyl)malonate Usage And Synthesis |  
 | Physical properties | Diethyl(phenylacetyl)malonate has a boiling point of 120 °C. Its density is predicted to be 1.148±0.06 g/cm3. |  | Uses | Organic synthesis intermediates. |  | Preparation | The anhydrous ethanol co-vaporized with diethyl phthalate and sodium metal is added dropwise to the mixture of diethyl malonate, carbon tetrachloride and magnesium, heated to start the reaction, and the temperature is controlled to smooth the reaction. Then add anhydrous diethyl ether, heat for 1h, add the diethyl ether solution of phenylacetyl chloride (add slowly, not to make the reaction too intense). After the reaction is completed, cool and add water, separate the oil layer, and evaporate the diethyl ether under reduced pressure to obtain diethyl(phenylacetyl)malonate. |  
  
 |  | Diethyl(phenylacetyl)malonate Preparation Products And Raw materials |  
  |