|
| | 3-Chloro-2-hydroxypropanesulfonic acid sodium salt Basic information |
| Product Name: | 3-Chloro-2-hydroxypropanesulfonic acid sodium salt | | Synonyms: | 1-Propanesulfonic acid,3-chloro-2-hydroxy-, sodiuM salt (1:1);Sodium 3-Chloro-2-hydroxypropanesulfonate(CHPS-Na);sodiumepichlorohydrinsulfonate;SODIUM 3-CHLORO-2-HYDROXYPROPANESULFONATE;CHPS-NA;3-CHLORO-2-HYDROXYPROPANESULFONIC ACID SODIUM SALT;sodium 3-chloro-2-hydroxypropanesulphonate;3-chloro-2-hydroxypropanesulphonic acid sodium salt | | CAS: | 126-83-0 | | MF: | C3H8ClNaO4S | | MW: | 198.59 | | EINECS: | 204-807-0 | | Product Categories: | | | Mol File: | 126-83-0.mol |  |
| | 3-Chloro-2-hydroxypropanesulfonic acid sodium salt Chemical Properties |
| density | 1.717[at 20℃] | | vapor pressure | 0Pa at 20℃ | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Soluble in water | | form | powder to crystal | | color | White to Almost white | | Water Solubility | 405g/L at 20℃ | | InChI | InChI=1S/C3H7ClO4S.Na.H/c4-1-3(5)2-9(6,7)8;;/h3,5H,1-2H2,(H,6,7,8);; | | InChIKey | TZLNJNUWVOGZJU-UHFFFAOYSA-M | | SMILES | C(C(O)CCl)S(O)(=O)=O.[NaH] | | LogP | -3.81 at 20℃ | | CAS DataBase Reference | 126-83-0(CAS DataBase Reference) | | EPA Substance Registry System | 1-Propanesulfonic acid, 3-chloro-2-hydroxy-, monosodium salt (126-83-0) |
| | 3-Chloro-2-hydroxypropanesulfonic acid sodium salt Usage And Synthesis |
| Chemical Properties | White crystalline powder | | Uses | 3-Chloro-2-hydroxypropanesulfonic acid sodium salt can be used as synthetic
polymers industry in important functional monomer, organic chemical
intermediates, surfactants, modified starch, drilling fluid loss
materials and other products. | | Application | 3-Chloro-2-hydroxypropanesulfonic acid sodium salt was used: - to prepare negatively charged probe particles to investigate effect of nanoporosity of cellulosic fibers on their streaming potential and their interactions with cationic polyelectrolytes;
- to prepare surface-derivatized microcrystalline cellulose (MCC) particles having either a strong positive or a strong negative zeta potential.
| | General Description | 3-Chloro-2-hydroxypropanesulfonic acid sodium salt is a novel anionic agent. | | Flammability and Explosibility | Notclassified |
| | 3-Chloro-2-hydroxypropanesulfonic acid sodium salt Preparation Products And Raw materials |
|
