|
| | METHYL 5-ACETYLSALICYLATE Basic information |
| | METHYL 5-ACETYLSALICYLATE Chemical Properties |
| Melting point | 62-64 °C (lit.) | | Boiling point | 167 °C / 15mmHg | | density | 1.0583 (rough estimate) | | refractive index | 1.5168 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Soluble in methanol. | | pka | 7.96±0.18(Predicted) | | form | Solid | | color | Off-WHite | | BRN | 2643824 | | InChI | InChI=1S/C10H10O4/c1-6(11)7-3-4-9(12)8(5-7)10(13)14-2/h3-5,12H,1-2H3 | | InChIKey | XLSMGNNWSRNTIQ-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C1=CC(C(C)=O)=CC=C1O | | CAS DataBase Reference | 16475-90-4(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 29189900 |
| | METHYL 5-ACETYLSALICYLATE Usage And Synthesis |
| Chemical Properties | white to light yellow-orange crystalline powder | | Uses | Methyl 5-acetylsalicylate is used in food flavorings and preservatives. It is useful in the relief of headache and muscle and joint aches It is also effective in reducing fever, inflammation, and swelling and thus has been used for treatment of rheumatoid arthritis, rheumatic fever, and mild infection. | | Preparation | Obtained by heating a solution of 5-acetyl-2-hydroxybenzoic acid and sulfuric acid in methanol for 24 h (82%). |
| | METHYL 5-ACETYLSALICYLATE Preparation Products And Raw materials |
|