|
| | BOC-L-Leucine Basic information |
| | BOC-L-Leucine Chemical Properties |
| Melting point | 85-87 °C | | Boiling point | 356.0±25.0 °C(Predicted) | | density | 1.061±0.06 g/cm3(Predicted) | | refractive index | -25 ° (C=2, AcOH) | | storage temp. | Sealed in dry,2-8°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | pka | 4.02±0.21(Predicted) | | form | Powder | | color | White | | optical activity | [α]20/D 25±0.5°, c = 2% in acetic acid | | BRN | 1711814 | | InChI | InChI=1S/C11H21NO4/c1-7(2)6-8(9(13)14)12-10(15)16-11(3,4)5/h7-8H,6H2,1-5H3,(H,12,15)(H,13,14)/t8-/m0/s1 | | InChIKey | URQQEIOTRWJXBA-QRPNPIFTSA-N | | SMILES | C(O)(=O)[C@H](CC(C)C)NC(OC(C)(C)C)=O | | CAS DataBase Reference | 13139-15-6(CAS DataBase Reference) | | EPA Substance Registry System | L-Leucine, N-[(1,1-dimethylethoxy)carbonyl]- (13139-15-6) |
| | BOC-L-Leucine Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | Protected amino acid with antimicrobial activity. | | Definition |
ChEBI: BOC-L-Leucine, also called N(alpha)-t-butoxycarbonyl-L-leucine is a L-leucine derivative obtained by the substitution of a t-butoxycarbonyl group on the nitrogen atom. It is a carbamate ester and a L-leucine derivative.
|
| | BOC-L-Leucine Preparation Products And Raw materials |
|