|  | |  |  | 2-Ethyl-2-adamantyl methacrylate Basic information | 
 | Product Name: | 2-Ethyl-2-adamantyl methacrylate |  | Synonyms: | 2-ethacryloyloxy-2-methyladamantane;2-Ethyl-2-adamantyl methacrylate;2-Ethyl-2-Adamanthyl Methacrylate;2-Ethyladamant-2-yl methacrylate;2-Ethyltricyclo[3.3.1.1~3,7~]dec-2-yl 2-methylprop-2-enoate, EADM;2-Ethyl-2-MethacryloyloxyadaMantane (stabilized with MEHQ);2-Ethyl-2-adamantyl Methacrylate
Methacrylic Acid 2-Ethyl-2-adamantyl Ester;2-Ethyl-2-methacryloyloxyadamantane |  | CAS: | 209982-56-9 |  | MF: | C16H24O2 |  | MW: | 248.36 |  | EINECS: |  |  | Product Categories: |  |  | Mol File: | 209982-56-9.mol |  |  | 
|  |  | 2-Ethyl-2-adamantyl methacrylate Chemical Properties | 
 | Melting point | 40 °C |  | Boiling point | 318.3±11.0 °C(Predicted) |  | density | 1.04±0.1 g/cm3(Predicted) |  | storage temp. | <0°C |  | solubility | soluble in Methanol |  | form | powder to lump |  | color | White to Almost white |  | InChI | InChI=1S/C16H24O2/c1-4-16(18-15(17)10(2)3)13-6-11-5-12(8-13)9-14(16)7-11/h11-14H,2,4-9H2,1,3H3 |  | InChIKey | DCTVCFJTKSQXED-UHFFFAOYSA-N |  | SMILES | C(OC1(CC)C2CC3CC1CC(C3)C2)(=O)C(C)=C |  | EPA Substance Registry System | 2-Propenoic acid, 2-methyl-, 2-ethyltricyclo[3.3.1.13,7]dec-2-yl ester (209982-56-9) | 
|  |  | 2-Ethyl-2-adamantyl methacrylate Usage And Synthesis | 
 | Uses | 2-Ethyl-2-adamantyl methacrylate is a monomer used in the synthesis of organic compounds. |  | Preparation | The preparation of 2-Ethyl-2-adamantyl methacrylate is as follows:Add 2175ml of n-hexane to the 3L four-necked flask equipped with stirring paddle, condenser tube and thermometer, turn on stirring, add 97g of 2-ethyladamantanol to the system, and slowly add 0.0072g of polymerization inhibitor tetrachlorobenzoquinone to the reaction system , add 72.5g of basic ion exchange resin, adjust pH=7-8, cool down to -10°C, slowly add 72.5g of vinyl methacrylate dropwise to the reaction system, keep the reaction for 6h, monitor the reaction progress, take a sample to detect the reaction is complete After adding 800 ml of water to the reaction system, stirring and extracting the phases, the organic phase was dried, concentrated under reduced pressure and evaporated to dryness to obtain 125 g of 2-ethyl-2-adamantyl methacrylate product with a yield of 93.45%. 
 | 
|  |  | 2-Ethyl-2-adamantyl methacrylate Preparation Products And Raw materials | 
 |