|
| | 2'-Deoxy-2'-fluoroguanosine Basic information |
| Product Name: | 2'-Deoxy-2'-fluoroguanosine | | Synonyms: | 2'-deoxy-2'-fluoroguanosine;2'-FdG;2'-Fluoro -2'-deoxyguanosine;2'-F-2'-dG;Guanosine,2'-deoxy-2'-fluoro-;2-amino-9-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purin-6-one;2'-Deoxy-2'-fluoroguanosine USP/EP/BP;2'-F-G | | CAS: | 78842-13-4 | | MF: | C10H12FN5O4 | | MW: | 285.23 | | EINECS: | 1806241-263-5 | | Product Categories: | Nucleosides | | Mol File: | 78842-13-4.mol |  |
| | 2'-Deoxy-2'-fluoroguanosine Chemical Properties |
| Melting point | 262-264 °C(Solv: water (7732-18-5)) | | density | 2.17±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | solubility | DMSO : 50 mg/mL (175.30 mM) | | pka | 9?+-.0.20(Predicted) | | form | Powder | | color | White to Off-white | | InChI | InChI=1S/C10H12FN5O4/c11-4-6(18)3(1-17)20-9(4)16-2-13-5-7(16)14-10(12)15-8(5)19/h2-4,6,9,17-18H,1H2,(H3,12,14,15,19)/t3-,4-,6-,9-/m1/s1 | | InChIKey | UXUZARPLRQRNNX-DXTOWSMRSA-N | | SMILES | OC[C@H]1O[C@@H](N2C3=C(C(NC(=N3)N)=O)N=C2)[C@H](F)[C@@H]1O |
| | 2'-Deoxy-2'-fluoroguanosine Usage And Synthesis |
| Uses | 2''-Deoxy-2''-fluoroguanosine, can be used as powerful tool for structural manipulation of G-quadruplexes. It is also a influenza viral polymerase inhibitor like Ribavirin (R414475), used as a antiviral drug against avian (H5N1) influenza virus. | | Synthesis | The synthesis of 2'-deoxy-2'-fluoroguanosine was accomplished using tetraisopropyldisiloxanyl (TPDS) protected 9-beta-D-arabinofuranosylguanine as starting material, and conversion to the intermediate diisobutyryl-arabinofuranosylguanosine. Deprotection of the TPDS group, was followed by protection of the hydroxyl group with THP to give diisobutyryl di-THP protected arabinofuranosylguanine. Selective O-deacylation and triflation was followed by treatment of the crude product with fluoride, then deprotection of the THP groups. |
| | 2'-Deoxy-2'-fluoroguanosine Preparation Products And Raw materials |
|