|
| | 4-Hydroxy-6,7-dimethoxyqunioline Basic information | | Appearance |
| Product Name: | 4-Hydroxy-6,7-dimethoxyqunioline | | Synonyms: | 6,7-Dimethoxy-4-hydroxyquinoline;4-hydroxy-(6,7-dimethoxyqunioine;6,7-DIMETHOXYQUINOLIN-4(1H)-ONE;4-HYDROXY-6,7-DIMETHOXYQUINOLINE;4-HYDROXY-6,7-DIMETHOXYQUNIOLINE;6,7-Dimethoxy-quinolin-4-ol;4-Quinolinol,6,7-diMethoxy-;6,7-DIMETHOXYQUINOLINE-4-OL | | CAS: | 13425-93-9 | | MF: | C11H11NO3 | | MW: | 205.21 | | EINECS: | 811-007-0 | | Product Categories: | Quinoline series;Heterocycles | | Mol File: | 13425-93-9.mol |  |
| | 4-Hydroxy-6,7-dimethoxyqunioline Chemical Properties |
| Melting point | 227.0 to 231.0 °C | | Boiling point | 370.9±37.0 °C(Predicted) | | density | 1.257±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly, Sonicated) | | form | powder to crystal | | pka | 4.26±0.40(Predicted) | | color | Light orange to Yellow to Green | | InChI | InChI=1S/C11H11NO3/c1-14-10-5-7-8(6-11(10)15-2)12-4-3-9(7)13/h3-6H,1-2H3,(H,12,13) | | InChIKey | QOGPNCUTXVZQSL-UHFFFAOYSA-N | | SMILES | N1C2C(=CC(OC)=C(OC)C=2)C(O)=CC=1 | | CAS DataBase Reference | 13425-93-9(CAS DataBase Reference) |
| HS Code | 2933.49.7000 | | HazardClass | IRRITANT |
| | 4-Hydroxy-6,7-dimethoxyqunioline Usage And Synthesis |
| Appearance | 4-Hydroxy-6,7-dimethoxyqunioline is a slightly pale yellow to yellow solid. | | Uses | 4-Hydroxy-6,7-dimethoxyqunioline, also called 6,7-Dimethoxy-4-quinolinol was used in the study of synthesis of ring-substituted 4-aminoquinolines and evaluation fo their antimalarial activities. | | storage | Store at room temperature. |
| | 4-Hydroxy-6,7-dimethoxyqunioline Preparation Products And Raw materials |
|
