|
| | Dipivefrin hydrochloride Basic information |
| Product Name: | Dipivefrin hydrochloride | | Synonyms: | dipivalylepinephrinehydrochloride;dipivefrinehydrochloride;dipivefrinhydrochloride;hydrochloride,(+-)-este;propanoicacid,2,2-dimethyl-,4-(1-hydroxy-2-(methylamino)ethyl)-1,2-phenylene;Progate;Propanoic acid,2,2-diMethyl-, 1,1'-[4-[1-hydroxy-2-(MethylaMino)ethyl]-1,2-phenylene] ester,hydrochloride (1:1);DIPIVEFRIN HYDROCHLORIDE (200 MG) | | CAS: | 64019-93-8 | | MF: | C19H30ClNO5 | | MW: | 387.8982 | | EINECS: | 264-609-5 | | Product Categories: | API | | Mol File: | 64019-93-8.mol |  |
| | Dipivefrin hydrochloride Chemical Properties |
| Melting point | 158-159° | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | Freely soluble in water, very soluble in methanol, freely soluble in ethanol (96 per cent) and in methylene chloride. | | pka | 8.40(at 25℃) | | form | neat | | color | White to Off-White | | InChI | InChI=1S/C19H29NO5.ClH/c1-18(2,3)16(22)24-14-9-8-12(13(21)11-20-7)10-15(14)25-17(23)19(4,5)6;/h8-10,13,20-21H,11H2,1-7H3;1H | | InChIKey | VKFAUCPBMAGVRG-UHFFFAOYSA-N | | SMILES | C1(OC(=O)C(C)(C)C)=CC(=CC=C1OC(=O)C(C)(C)C)C(O)CNC.Cl |
| RIDADR | UN 2811 6.1 / PGIII | | HS Code | 2922504500 |
| | Dipivefrin hydrochloride Usage And Synthesis |
| Description | Dipivefrin hydrochloride is an antiglaucoma prothrombotic drug that is hydrolyzed to its active compound epinephrine by esterases in the cornea. | | Chemical Properties | White or almost white, crystalline powder. | | Uses | Dipivefrine Hydrochloride acts as an anti-glaucoma agent. | | Uses | Adrenergic (ophthalmic) | | Definition | ChEBI: The hydrochloride salt of dipivefrin. It is used topically as eye drops to reduce intra-ocular pressure in the treatment of open-angle glaucoma or ocular hypertension. | | Brand name | Akpro (Akorn); Propine (Allergan). | | in vivo | Dipivefrin hydrochloride (0.3-10 μg/kg; i.p.;) induces enhancement of memory involves central beta- but not alpha-adrenergic mechanisms. |
| | Dipivefrin hydrochloride Preparation Products And Raw materials |
|