|
| | Perfluorotriethylamine Basic information |
| Product Name: | Perfluorotriethylamine | | Synonyms: | PERFLUOROTRIETHYLAMINE;1,1,2,2,2-Pentafluoro-N,N-bis(1,1,2,2,2-pentafluoroethyl)ethanamine;1,1,2,2,2-pentafluoro-n,n-bis(pentafluoroethyl)-ethanamin;Ethanamine, 1,1,2,2,2-pentafluoro-N,N-bis(pentafluoroethyl)-;TRIS(PENTAFLUOROETHYL)AMINE;n,n-bis(pentafluoroethyl)-1,1,2,2,2-pentafluoroethanamine;n,n-bis(pentafluoroethyl)-1,1,2,2,2-pentalfluoro-ethanamin;pentadecafluoro-1,1-diethylethanamine | | CAS: | 359-70-6 | | MF: | C6F15N | | MW: | 371.05 | | EINECS: | 206-632-5 | | Product Categories: | | | Mol File: | 359-70-6.mol |  |
| | Perfluorotriethylamine Chemical Properties |
| Melting point | -116.95°C | | Boiling point | 68-69 °C743 mm Hg(lit.) | | density | 1.736 g/mL at 25 °C(lit.) | | vapor pressure | 2.15 psi ( 20 °C) | | refractive index | n20/D 1.262(lit.) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | -27.46±0.50(Predicted) | | form | liquid | | color | clear colourless | | Specific Gravity | 1.736 | | InChI | InChI=1S/C6F15N/c7-1(8,9)4(16,17)22(5(18,19)2(10,11)12)6(20,21)3(13,14)15 | | InChIKey | CBEFDCMSEZEGCX-UHFFFAOYSA-N | | SMILES | C(N(C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F)(F)(F)C(F)(F)F | | CAS DataBase Reference | 359-70-6(CAS DataBase Reference) | | NIST Chemistry Reference | Tris(pentafluoroethyl)amine(359-70-6) | | EPA Substance Registry System | Perfluorotriethylamine (359-70-6) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | RIDADR | UN 3267 8/PG III | | WGK Germany | 3 | | RTECS | KH2155170 | | Hazard Note | Irritant | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29211990 |
| | Perfluorotriethylamine Usage And Synthesis |
| Uses | Perfluorotriethylamine is used for toxicity test, cytotoxicity, genotoxicity and pyrolysis experiments. |
| | Perfluorotriethylamine Preparation Products And Raw materials |
|
