|
| | 3,5-Bis(2-cyanoprop-2-yl)toluene Basic information |
| Product Name: | 3,5-Bis(2-cyanoprop-2-yl)toluene | | Synonyms: | PENTAMETHYL-1,3-BENZENEDIACETONITRILE;2,2'-(5-METHYL-1,3-PHENYLENE)DI(2-METHYLPROPANENITRILE);2,2'-(5-methyl-1,3-phenylene)di(2-methylpropionitrile);3,5-Bis (2-cyanoisopropyl ) toluene;2,2’-(5-Methyl-1,3-phenylene)-di(2-methylpropiononitrile;2,2'-(5-Methyl-1,3-Phenylene)Bis(2-Methylpropanenitrile);2,2-(5-Methyl-1,3-Phenylene)-Bis-(2-Methyl-Propionitrile);3,5-Bis(2-Cyanoisopropyl)Toluene(ForAnastrozole) | | CAS: | 120511-72-0 | | MF: | C15H18N2 | | MW: | 226.32 | | EINECS: | 1806241-263-5 | | Product Categories: | Intermediate of Anastrozole;INTERMEDIATESOFANASTROZOLE;Anastrozole;Nitriles;(intermediate of anastrozole);Aromatics;Inhibitors;Intermediates & Fine Chemicals;Isotope Labelled Compounds;Pharmaceuticals;Anastrazole | | Mol File: | 120511-72-0.mol |  |
| | 3,5-Bis(2-cyanoprop-2-yl)toluene Chemical Properties |
| Melting point | 127-130°C | | Boiling point | 339.1±32.0 °C(Predicted) | | density | 1.002±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Sparingly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | InChI | InChI=1S/C15H18N2/c1-11-6-12(14(2,3)9-16)8-13(7-11)15(4,5)10-17/h6-8H,1-5H3 | | InChIKey | SJECEXNMZXMXNE-UHFFFAOYSA-N | | SMILES | C1(=CC(C)=CC(C(C)(C)C#N)=C1)C(C)(C)C#N | | CAS DataBase Reference | 120511-72-0(CAS DataBase Reference) |
| | 3,5-Bis(2-cyanoprop-2-yl)toluene Usage And Synthesis |
| Chemical Properties | 3,5-Bis(2-cyanoprop-2-yl)toluene is White Solid
| | Uses | 3,5-Bis(2-cyanoprop-2-yl)toluene is a labelled intermediate in the synthesis of Anastrozole, an aromatase inhibitor. Used as an antineoplastic.
| | Uses | α,α,α’,α’-Tetramethyl-5-methyl-1,3-benzenediacetonitrile (Anastrozole EP Impurity H) is an intermediate in the synthesis of Anastrozole (A637425), an aromatase inhibitor. Used as an antineoplastic. | | Uses | An intermediate in the synthesis of Anastrozole (A637425), an aromatase inhibitor. Used as an antineoplastic. |
| | 3,5-Bis(2-cyanoprop-2-yl)toluene Preparation Products And Raw materials |
|