|
| | Meta-Topolin Basic information |
| Product Name: | Meta-Topolin | | Synonyms: | meta-TOPOLIN(mT);3-[(9H-Purin-6-ylamino)methyl]phenol;META-TOPOLIN SOLUTION;6-(3-Hydroxybenzylamino)purine;Phenol, 3-[(9H-purin-6-ylamino)methyl]-;meta-Topoline;meta-Topolin (mT) for molecular biology, 98%;3-[(7H-purin-6-ylamino)methyl]phenol | | CAS: | 75737-38-1 | | MF: | C12H11N5O | | MW: | 241.25 | | EINECS: | | | Product Categories: | Plantgrowth | | Mol File: | 75737-38-1.mol |  |
| | Meta-Topolin Chemical Properties |
| Melting point | 284-286℃ | | Boiling point | 458.1±55.0 °C(Predicted) | | density | 1.49 | | storage temp. | Store at -20°C | | solubility | DMF: 10 mg/ml; DMSO: 30 mg/ml; DMSO:PBS (pH 7.2) (1:5): 0.16 mg/ml | | form | A solid | | pka | 9.89±0.10(Predicted) | | InChI | InChI=1S/C12H11N5O/c18-9-3-1-2-8(4-9)5-13-11-10-12(15-6-14-10)17-7-16-11/h1-4,6-7,18H,5H2,(H2,13,14,15,16,17) | | InChIKey | BUDWTFCZGZYQHZ-UHFFFAOYSA-N | | SMILES | C1(O)=CC=CC(CNC2=C3C(=NC=N2)NC=N3)=C1 |
| | Meta-Topolin Usage And Synthesis |
| Uses | Meta-Topolin (m-Topolin) is a highly active aromatic cytokinin. | | Biological Activity | Meta-topolin [6-(3-hydroxybenzylamino)purine] is an aromatic cytokinin. It was first isolated from poplar leaves. Its name is derived from “topol”, the Czech word for poplar. The metabolism of meta-topolin is similar to that of other cytokinins. Just as zeatin and BAP, meta-topolin may undergo ribosylation at position 9 without a significant effect on the activity. In Spathiphyllum floribundum, shoot production in media with BAP and meta-topolin is very similar. However, after transfer to the soil, the shoots produced with meta-topolin root much better during acclimatization. |
| | Meta-Topolin Preparation Products And Raw materials |
|
