|
| | 3,5-Difluorochlorobenzene Basic information |
| Product Name: | 3,5-Difluorochlorobenzene | | Synonyms: | 3,5-DIFLUOROCHLOROBENZENE;1-Chloro-3,5-difluorobenzene 97%;1-Chloro-3,5-difluorobenzene97%;3,5-Difluorchlorbenzol;1-Chloro-3,5-difluorobenzene,95%;1-CHLORO-3,5-DIFLUOROBENZENE;3,5-Difluorochlorobenzene 97%;3,5-Difluorochlorobenzene 97%, 5-Difluorochlorobenzene 97% | | CAS: | 1435-43-4 | | MF: | C6H3ClF2 | | MW: | 148.54 | | EINECS: | 627-820-7 | | Product Categories: | Aryl Fluorinated Building Blocks;Building Blocks;Chemical Synthesis;Fluorinated Building Blocks;Halogenated Hydrocarbons;Organic Building Blocks;Trifluoromethoxybenzene Series;Miscellaneous;Aryl;C6;Halogenated Hydrocarbons;Organic Fluorinated Building Blocks;Other Fluorinated Organic Building Blocks | | Mol File: | 1435-43-4.mol |  |
| | 3,5-Difluorochlorobenzene Chemical Properties |
| Boiling point | 111-112 °C (lit.) | | density | 1.329 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.465(lit.) | | Fp | 85 °F | | storage temp. | Sealed in dry,Room Temperature | | form | clear liquid | | color | Colorless to Almost colorless | | BRN | 2205670 | | InChI | InChI=1S/C6H3ClF2/c7-4-1-5(8)3-6(9)2-4/h1-3H | | InChIKey | RFKBODCWHNDUTJ-UHFFFAOYSA-N | | SMILES | C1(Cl)=CC(F)=CC(F)=C1 | | CAS DataBase Reference | 1435-43-4(CAS DataBase Reference) |
| Hazard Codes | Xi,F | | Risk Statements | 10-36/37/38 | | Safety Statements | 37/39-26-16 | | RIDADR | UN 1993 3/PG 3 | | WGK Germany | 2 | | Hazard Note | Flammable | | HazardClass | 3 | | PackingGroup | III | | HS Code | 29039990 |
| | 3,5-Difluorochlorobenzene Usage And Synthesis |
| Chemical Properties | clear colourless liquid |
| | 3,5-Difluorochlorobenzene Preparation Products And Raw materials |
| Raw materials | 1,3-Dimethyl-2-imidazolidinone-->2,4-Difluoroacetanilide-->2,4-DIFLUORO-6-NITROANILINE-->2-CHLORO-4,6-DIFLUOROANILINE-->1,3-Diethylbenzene-->3,5-Difluoronitrobenzene-->1,3,5-Trichlorobenzene | | Preparation Products | 3-CHLORO-5-FLUOROPHENYLACETIC ACID-->1,3,5-Trifluorobenzene |
|
