|
| | Ethyl N-(2,3-dichloro-6-aminobenzyl)glcycine Basic information |
| Product Name: | Ethyl N-(2,3-dichloro-6-aminobenzyl)glcycine | | Synonyms: | Ethyl-N-(2,3-dichloro-6-aminobenzyl)glcycine;N-(6-Amino-2,3-dichlorobenzyl)glycineethylester;Ethyl 2-(6-Amino-2,3-dichlorobenzyl)glycine(Anagrelide Impurity A);Ethyl 2-(6-Amino-2,3-dichlorobenzyl)glycine;ethyl 2-((6-amino-2,3-dichlorobenzyl)amino)acetate;Anagrelide Intermediate;Glycine, N-[(6-amino-2,3-dichlorophenyl)methyl]-, ethyl ester;Ethyl N-(2,3-dichloro-6-aminobenzyl)glcycine USP/EP/BP | | CAS: | 70406-92-7 | | MF: | C11H14Cl2N2O2 | | MW: | 277.15 | | EINECS: | 813-025-4 | | Product Categories: | Amines;Bases & Related Reagents;Impurities;Intermediates & Fine Chemicals;Nucleotides;Pharmaceuticals | | Mol File: | 70406-92-7.mol |  |
| | Ethyl N-(2,3-dichloro-6-aminobenzyl)glcycine Chemical Properties |
| Boiling point | 402.4±45.0 °C(Predicted) | | density | 1.318±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | pka | 5.45±0.20(Predicted) | | InChI | InChI=1S/C11H14Cl2N2O2/c1-2-17-10(16)6-15-5-7-9(14)4-3-8(12)11(7)13/h3-4,15H,2,5-6,14H2,1H3 | | InChIKey | GXKCDDOGWWCMAO-UHFFFAOYSA-N | | SMILES | C(OCC)(=O)CNCC1=C(N)C=CC(Cl)=C1Cl |
| | Ethyl N-(2,3-dichloro-6-aminobenzyl)glcycine Usage And Synthesis |
| Uses | Anagrelide impurity A. |
| | Ethyl N-(2,3-dichloro-6-aminobenzyl)glcycine Preparation Products And Raw materials |
|