|
| | 3-Chlorophenylboronic acid Basic information |
| | 3-Chlorophenylboronic acid Chemical Properties |
| Melting point | 185-189 °C(lit.) | | Boiling point | 311.4±44.0 °C(Predicted) | | density | 1.32±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | soluble in Methanol | | pka | 7.55±0.10(Predicted) | | form | Crystalline Powder or Needles | | color | White to light yellow-green | | Water Solubility | Slightly soluble in water. soluble in ether, tetrahydrofuran,, dimethyl sulfoxide, dimethyl formamide, methanol. | | BRN | 2936343 | | InChI | InChI=1S/C6H6BClO2/c8-6-3-1-2-5(4-6)7(9)10/h1-4,9-10H | | InChIKey | SDEAGACSNFSZCU-UHFFFAOYSA-N | | SMILES | B(C1=CC=CC(Cl)=C1)(O)O | | CAS DataBase Reference | 63503-60-6(CAS DataBase Reference) |
| | 3-Chlorophenylboronic acid Usage And Synthesis |
| Chemical Properties | white to light yellow-green crystalline powder or | | Uses | Reactant involved in:
- 1,4-conjugate addition reactions with ethenesulfonamides to form arylethanesulfonamides
- Suzuki-Miyaura reactions with dibromotrifluoromethylbenzene
- Cross-coupling reactions with diazoesters or potassium cyanate
- Synthesis of biarylketones and phthalides
- Synthesis of inhibitors including PDE4 inhibitors among others
| | Uses | It is employed as a reactant involved in 1,4-conjugate addition reactions with ethenesulfonamides to form arylethanesulfonamides, Suzuki-Miyaura reactions with dibromotrifluoromethylbenzene, cross-coupling reactions with diazoesters3 or potassium cyanate. It is involved in the synthesis of biarylketones and phthalides and synthesis of inhibitors including PDE4 inhibitors6 among others. | | Uses | suzuki reaction |
| | 3-Chlorophenylboronic acid Preparation Products And Raw materials |
|
