|  | |  |  | 2-Chloroanthraquinone Basic information | 
|  |  | 2-Chloroanthraquinone Chemical Properties | 
 | Melting point | 209-211 °C (lit.) |  | Boiling point | 345.65°C (rough estimate) |  | density | 1.2377 (rough estimate) |  | refractive index | 1.5380 (estimate) |  | storage temp. | Sealed in dry,Room Temperature |  | form | powder to crystal |  | color | White to Light orange to Yellow |  | Water Solubility | insoluble |  | BRN | 2051842 |  | InChI | InChI=1S/C14H7ClO2/c15-8-5-6-11-12(7-8)14(17)10-4-2-1-3-9(10)13(11)16/h1-7H |  | InChIKey | FPKCTSIVDAWGFA-UHFFFAOYSA-N |  | SMILES | C1=C2C(C(=O)C3=C(C2=O)C=CC=C3)=CC=C1Cl |  | CAS DataBase Reference | 131-09-9(CAS DataBase Reference) |  | NIST Chemistry Reference | 2-Chloroanthraquinone(131-09-9) |  | EPA Substance Registry System | 9,10-Anthracenedione, 2-chloro- (131-09-9) | 
|  |  | 2-Chloroanthraquinone Usage And Synthesis | 
 | Chemical Properties | Pale yellow needle crystal. Insoluble in water, soluble in hot benzene, nitrobenzene, concentrated sulfuric acid. |  | Uses | 2-Chloroanthraquinone is an important dye intermediate that can be used to make alizarin and aminoanthraquinone. This product has been evaluated as a photo-reagent for the analysis of ginsenosides using photoreduction fluorescence (PRF) detection method. |  | Preparation | 2-Chloroanthraquinone is prepared by condensing phthalic anhydride and chlorobenzene into p-chlorobenzoylbenzoic acid, and then cyclizing it with sulfuric acid. |  | Synthesis Reference(s) | Tetrahedron Letters, 24, p. 5499, 1983 DOI: 10.1016/S0040-4039(00)94122-4 | 
|  |  | 2-Chloroanthraquinone Preparation Products And Raw materials | 
 |