|
| | 3-Carboxyphenylboronic acid Basic information |
| | 3-Carboxyphenylboronic acid Chemical Properties |
| Melting point | 243-247 °C (lit.) | | Boiling point | 434.5±47.0 °C(Predicted) | | density | 1.40±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) | | pka | 4.21±0.10(Predicted) | | form | Crystalline Powder | | color | Off-white | | Water Solubility | 2.5 g/100 mL | | BRN | 2967400 | | InChI | InChI=1S/C7H7BO4/c9-7(10)5-2-1-3-6(4-5)8(11)12/h1-4,11-12H,(H,9,10) | | InChIKey | DBVFWZMQJQMJCB-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=CC(B(O)O)=C1 | | CAS DataBase Reference | 25487-66-5(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-20/21/22 | | Safety Statements | 37/39-26-36 | | WGK Germany | 2 | | RTECS | CY8750000 | | HazardClass | IRRITANT | | HS Code | 29163990 | | Toxicity | mouse,LD50,intravenous,2560mg/kg (2560mg/kg),"Boron, Metallo-Boron Compounds and Boranes," Adams, R.M., ed., New York, John Wiley & Sons, Inc., 1964Vol. -, Pg. 693, 1964. |
| | 3-Carboxyphenylboronic acid Usage And Synthesis |
| Chemical Properties | 3-Carboxyphenylboronic acid is off-white crystalline powder
| | Uses | 3-Carboxyphenylboronic acid can be used as a substrate in the preparation of:
- Biaryl derivatives by reacting with bromoaniline through the Suzuki-Miyaura coupling reaction.
- Boronic acid-functionalized block copolymer.
- 1H-Imidazo[1,2-a]quinoxaline derivatives.
| | Uses | suzuki reaction | | Uses | 3-Carboxyphenylboronic acid is used in Suzuki coupling chemistry.1,2,3
|
| | 3-Carboxyphenylboronic acid Preparation Products And Raw materials |
|
