| 
 |  | FMOC-L-Methionine Basic information |  
  
 |  | FMOC-L-Methionine Chemical Properties |  
 | Melting point  | 121-123 °C(lit.) |  | alpha  | -29 º (c=1,DMF 24 ºC) |  | Boiling point  | 614.6±55.0 °C(Predicted) |  | density  | 1.2053 (rough estimate) |  | refractive index  | -29.5 ° (C=1, DMF) |  | storage temp.  | 2-8°C |  | solubility  | very faint turbidity in Methanol |  | pka | 3.72±0.10(Predicted) |  | form  | Granular Powder |  | color  | White |  | optical activity | [α]20/D -29.5±1.5°, c = 1% in DMF |  | BRN  | 4300266 |  | InChI | InChI=1S/C20H21NO4S/c1-26-11-10-18(19(22)23)21-20(24)25-12-17-15-8-4-2-6-13(15)14-7-3-5-9-16(14)17/h2-9,17-18H,10-12H2,1H3,(H,21,24)(H,22,23)/t18-/m0/s1 |  | InChIKey | BUBGAUHBELNDEW-SFHVURJKSA-N |  | SMILES | C(O)(=O)[C@H](CCSC)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O |  | CAS DataBase Reference | 71989-28-1(CAS DataBase Reference) |  
  
 |  | FMOC-L-Methionine Usage And Synthesis |  
 | Chemical Properties | white to light yellow crystal powde |  | Uses | N-Fmoc-L-methionine is an N-Fmoc-protected form of L-Methionine (M260440). L-Methionine is an essential amino acid that is obtained from our diet. L-Methionine can be found in grain legumes (such as lentils), and poultry. L-Methionine’s main function is to act as the primary “Start” sequence on mRNA so that the ribosomes can start translating the mRNA into proteins. |  
  
 |  | FMOC-L-Methionine Preparation Products And Raw materials |  
  
 
 |