|
| | 1,2-Dimethylpropylamine Basic information |
| | 1,2-Dimethylpropylamine Chemical Properties |
| Melting point | -50 °C (lit.) | | Boiling point | 84-87 °C (lit.) | | density | 0.757 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.4055(lit.) | | Fp | −18 °F | | solubility | Chloroform (Sparingly), Methanol (Slightly) | | pka | 10.80±0.10(Predicted) | | form | Oil | | color | Colourless | | BRN | 635656 | | InChI | InChI=1S/C5H13N/c1-4(2)5(3)6/h4-5H,6H2,1-3H3 | | InChIKey | JOZZAIIGWFLONA-UHFFFAOYSA-N | | SMILES | CC(N)C(C)C | | CAS DataBase Reference | 598-74-3(CAS DataBase Reference) | | NIST Chemistry Reference | 2-Butanamine, 3-methyl-(598-74-3) | | EPA Substance Registry System | 3-Methyl-2-butanamine (598-74-3) |
| Hazard Codes | F,C | | Risk Statements | 11-21/22-34 | | Safety Statements | 16-26-27-36/37/39-45 | | RIDADR | UN 3286 3/PG 2 | | WGK Germany | 3 | | RTECS | UI1100000 | | HazardClass | 3 | | PackingGroup | II | | HS Code | 2921199990 | | Toxicity | LD50 ipr-mus: 279 mg/kg JJPAAZ 17,475,67 |
| | 1,2-Dimethylpropylamine Usage And Synthesis |
| Chemical Properties | White powder solid | | Uses | 1,2-Dimethylpropylamine was used as standard in separation of alkali and alkaline earth metal cations by capillary electrochromatography on monolithic octadecylsilica columns. | | Safety Profile | Poison by
intraperitoneal route. A flammable liquid.
When heated to decomposition it emits
toxic vapors of NOx. |
| | 1,2-Dimethylpropylamine Preparation Products And Raw materials |
|
