|
| | H-D-PHG-OME HCL Basic information |
| | H-D-PHG-OME HCL Chemical Properties |
| Melting point | 189-191 °C(lit.) | | alpha | -118o (C=1 IN H2O) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | powder to crystal | | color | White to Almost white | | optical activity | [α]20/D 118°, c = 1 in H2O | | BRN | 3915654 | | InChI | InChI=1/C9H11NO2.ClH/c1-12-9(11)8(10)7-5-3-2-4-6-7;/h2-6,8H,10H2,1H3;1H/t8-;/s3 | | InChIKey | DTHMTBUWTGVEFG-DDWIOCJRSA-N | | SMILES | C(OC)(=O)[C@H](C1=CC=CC=C1)N.[H]Cl |&1:4,r| | | CAS DataBase Reference | 19883-41-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26-36/37 | | WGK Germany | 3 | | HS Code | 29224999 |
| | H-D-PHG-OME HCL Usage And Synthesis |
| Chemical Properties | White solid | | Uses | (R)-(-)-2-Phenylglycine Methyl Ester Hydrochloride is an intermediate in the synthesis of Cephradine, a cephalosporin antibiotic. It functions as an acyl donor in the enzymatic synthetic process for cephradine synthesis. |
| | H-D-PHG-OME HCL Preparation Products And Raw materials |
|