|
| | Nefiracetam Basic information |
| | Nefiracetam Chemical Properties |
| Melting point | 151-155°C | | Boiling point | 458.5±33.0 °C(Predicted) | | density | 1.187±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO: >5mg/mL | | pka | 13.77±0.70(Predicted) | | form | solid | | color | white to off-white | | Merck | 14,6439 | | InChI | InChI=1S/C14H18N2O2/c1-10-5-3-6-11(2)14(10)15-12(17)9-16-8-4-7-13(16)18/h3,5-6H,4,7-9H2,1-2H3,(H,15,17) | | InChIKey | NGHTXZCKLWZPGK-UHFFFAOYSA-N | | SMILES | N1(CC(NC2=C(C)C=CC=C2C)=O)CCCC1=O | | CAS DataBase Reference | 77191-36-7(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | RTECS | UX9655650 | | HS Code | 2933.79.1500 | | Toxicity | LD50 in mice (mg/kg): 421 i.v.; 1766 orally (Betzing, 1982) |
| | Nefiracetam Usage And Synthesis |
| Uses | analgesic, antiinflammatory | | Uses | Nefiracetam improves post-ischemia evoke-nonconvulsive seizure by altering pro-inflammatory cytokines. | | Definition | ChEBI: Nefiracetam is an organooxygen compound and an organonitrogen compound. It is functionally related to an alpha-amino acid. | | Biological Activity | Cognitive enhancer that displays various pharmacological effects. Activates L/N-type calcium channels, cholinergic, monoaminergic and GABAergic systems. Displays potent neuroprotective action in the retinal ischemia-reperfusion model in vivo . | | storage | Store at RT |
| | Nefiracetam Preparation Products And Raw materials |
|