|
| | 3-Dimethylaminopropane-1,2-diol Basic information |
| Product Name: | 3-Dimethylaminopropane-1,2-diol | | Synonyms: | 1,2-Propanediol, 3-(dimethylamino)-;γ-Dimethylaminopropylene glycol;N,N-DIMETHYL-3-AMINO-1,2-PROPANEDIOL;N,N-DIMETHYL-2,3-DIHYDROXYPROPYLAMINE;1-Dimethylamino-2,3-propanediol;3-(dimethylamino)-2-propanediol;3-(Dimethylamino)-1,2-Propaned;3-Dimethylamino-1,2-Propanediol（N,N-Dimethyl-3-Amino-1,2-propanediol) | | CAS: | 623-57-4 | | MF: | C5H13NO2 | | MW: | 119.16 | | EINECS: | 210-802-4 | | Product Categories: | Amino Alcohols;Organic Building Blocks;Oxygen Compounds | | Mol File: | 623-57-4.mol |  |
| | 3-Dimethylaminopropane-1,2-diol Chemical Properties |
| Boiling point | 216-217 °C(lit.) | | density | 1.004 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.4609(lit.) | | Fp | 221 °F | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 14.13±0.20(Predicted) | | form | clear liquid | | color | Colorless to Light yellow | | Specific Gravity | 1.001.004 | | Stability: | Stable. Incompatible with oxidizing agents, acids. | | InChI | InChI=1S/C5H13NO2/c1-6(2)3-5(8)4-7/h5,7-8H,3-4H2,1-2H3 | | InChIKey | QCMHUGYTOGXZIW-UHFFFAOYSA-N | | SMILES | C(O)C(O)CN(C)C | | CAS DataBase Reference | 623-57-4(CAS DataBase Reference) | | NIST Chemistry Reference | 1,2-Propanediol, 3-(dimethylamino)-(623-57-4) | | EPA Substance Registry System | 1,2-Propanediol, 3-(dimethylamino)- (623-57-4) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 23-26-27-36/37/39-45 | | RIDADR | UN 3267 8/PG 2 | | WGK Germany | 3 | | HazardClass | 8 | | PackingGroup | III | | HS Code | 2922190090 |
| | 3-Dimethylaminopropane-1,2-diol Usage And Synthesis |
| Chemical Properties | pale yellow solid | | Uses | 3-(Dimethylamino)-1,2-propanediol was used in the preparation of:
- synthetic cationic lipid, N-[1-(2,3-dioleyloxy)propyl-N,N,N-trimethylammonium chloride (DOTMA), used in DNA-transfection protocol
- indane-derived bis(oxazolines)
|
| | 3-Dimethylaminopropane-1,2-diol Preparation Products And Raw materials |
|
