| 
 |  | Fmoc-L-Serine Basic information |  
  
 |  | Fmoc-L-Serine Chemical Properties |  
 | Melting point  | 104-106°C |  | alpha  | -12.5 º (c=1%, DMF) |  | Boiling point  | 599.3±50.0 °C(Predicted) |  | density  | 1.362±0.06 g/cm3(Predicted) |  | refractive index  | -12.5 ° (C=1, DMF) |  | storage temp.  | 2-8°C |  | solubility  | soluble in Methanol |  | pka | 3.51±0.10(Predicted) |  | form  | powder to crystal |  | color  | White to Light yellow |  | optical activity | [α]20/D 12.5±1°, c = 1% in DMF |  | BRN  | 4715791 |  | InChI | InChI=1S/C18H17NO5/c20-9-16(17(21)22)19-18(23)24-10-15-13-7-3-1-5-11(13)12-6-2-4-8-14(12)15/h1-8,15-16,20H,9-10H2,(H,19,23)(H,21,22)/t16-/m0/s1 |  | InChIKey | JZTKZVJMSCONAK-INIZCTEOSA-N |  | SMILES | C(O)(=O)[C@H](CO)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O |  | CAS DataBase Reference | 73724-45-5(CAS DataBase Reference) |  
  
 |  | Fmoc-L-Serine Usage And Synthesis |  
 | Chemical Properties | Light yellow powder |  | Uses | N-Fmoc-L-serine is an N-Fmoc-protected form of L-Serine (S270975). L-Serine is a nonessential amino acid that is required for the synthesis of sphingolipids and phosphatidylserine, compounds that are important for central nervous system neuronal survival. L-Serine is also important in intermediary metabolism in eukaryotic cells. |  
  
 |  | Fmoc-L-Serine Preparation Products And Raw materials |  
  |