|
| | Strychnine Nitrate Basic information |
| | Strychnine Nitrate Chemical Properties |
| Melting point | 295°C | | Boiling point | 520.88°C (rough estimate) | | density | 1.6270 | | refractive index | 1.6300 (estimate) | | storage temp. | Refrigerator | | solubility | Chloroform (Slightly), Methanol (Slightly), Water (Slightly) | | form | Solid | | color | White to Off-White | | Merck | 14,8855 | | InChIKey | PCGVPMHGSJFFTI-AYCNAOTENA-N | | SMILES | [C@]123[C@@H]4C[C@@]5([H])C(=CCO[C@@]6([H])CC(=O)N(C7C=CC=CC1=7)[C@@]2([H])[C@@]56[H])CN4CC3.[N+]([O-])(=O)O |&1:0,1,3,9,21,23,r| | | CAS DataBase Reference | 66-32-0(CAS DataBase Reference) |
| | Strychnine Nitrate Usage And Synthesis |
| Chemical Properties | Strychnine Nitrate is a highly toxic, colorless, bitter, crystalline alkaloid.The toxicity of strychnine nitrate is similar to that of strychnine alone.
| | Uses | Strychnine nitrate is a chemical compound that is made up of strychnine and nitric acid. It is used as a pesticide, particularly for killing small vertebrates such as birds and rodents. | | General Description | Strychnine is is an poisonous alkaloid extract obtained
from the dried ripe seeds of Strychnos nux vomica, a
small tree of the East Indies. It is obtained as a white
crystalline substance, having a very bitter acrid taste,
and is used in research as a powerful neurostimulant. |
| | Strychnine Nitrate Preparation Products And Raw materials |
|
